Genkwanin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 404360484

| Name = Genkwanin

| ImageFile = Genkwanin v2.svg

| ImageSize = 200

| ImageAlt = Skeletal formula of genkwanin

| ImageFile1 = Genkwanin molecule ball.png

| ImageSize1 = 220

| ImageAlt1 = Ball-and-stick model of genkwanin

| IUPACName = 4′,5-Dihydroxy-7-methoxyflavone

| SystematicName = 5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one

| OtherNames = Gengkwanin
Apigenin 7-methyl ether
4′,5-dihydroxy-7-methoxy flavone
5,4′-Dihydroxy-7-methoxyflavone
5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxychromen-4-one

|Section1={{Chembox Identifiers

| CASNo = 437-64-9

| CASNo_Ref = {{cascite|correct|??}}

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5K3I5D6B2B

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 210635

| SMILES = COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O

| PubChem = 5281617

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4444936

| SMILES2 = COc1cc(c2c(=O)cc(oc2c1)c3ccc(cc3)O)O

| InChI = 1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3

| InChIKey = JPMYFOBNRRGFNO-UHFFFAOYAO

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JPMYFOBNRRGFNO-UHFFFAOYSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C = 16 | H = 12 | O = 5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Genkwanin is an O-methylated flavone, a type of flavonoid. It can be found in the seeds of Alnus glutinosa,{{cite journal | title=Hirsutanonol, oregonin and genkwanin from the seeds of Alnus glutinosa (Betulaceae) | last1=O'Rourke | first1=Ciara | last2=Byres | first2=Maureen | last3=Delazar | first3=Abbas | last4=Kumarasamy | first4=Yashodharan | last5=Nahar | first5=Lutfun | last6=Stewart | first6=Fiona | last7=Sarker | first7=Satyajit D. | journal=Biochemical Systematics and Ecology | year=2005 | volume=33 | issue=7 | pages=749–752 | url=http://cat.inist.fr/?aModele=afficheN&cpsidt=16859150 | doi=10.1016/j.bse.2004.10.005 | bibcode=2005BioSE..33..749O | access-date=2010-02-23 | archive-date=2012-08-23 | archive-url=https://web.archive.org/web/20120823070915/http://cat.inist.fr/?aModele=afficheN&cpsidt=16859150 | url-status=dead | url-access=subscription }} in the leaves of the ferns Notholaena bryopoda and Asplenium normale,{{cite journal | title=Flavonoid distribution in asplenioid ferns | first1=Yusuf | last1=UmiKalsom | first2=Jeffrey B. | last2=Harborne | journal=Pertanika | year=1991 | volume=14 | issue=3 | pages=297–300}} and in the leaves of trees in the genus Aquilaria. {{cite book | last1 = Kakino | first1 = Mamoru |last2 = Hara | first2 = Hideaki| title = Agarwood | chapter = Pharmacological Effects of Aquilaria SPP. Leaves and Their Chemical Constituents | series = Tropical Forestry | year = 2016 | pages = 125–136 | doi = 10.1007/978-981-10-0833-7_8 | isbn = 978-981-10-0832-0 | chapter-url=https://link.springer.com/chapter/10.1007/978-981-10-0833-7_8}}