Gidazepam

{{Short description|Benzodiazepine medication}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461120451

| IUPAC_name = 2-(9-Bromo-3-oxo-6-phenyl-2,5-diazabicyclo[5.4.0]undeca-5,8,10,12-tetraen-2-yl)acetohydrazide

| image = Gidazepam.svg

| image_class = skin-invert-image

| width = 150

| image2 = Gidazepam ball-and-stick model.png

| width2 = 170

| tradename = Gidazepam IC

| pregnancy_category =

| legal_CA = Schedule IV

| legal_US = Unscheduled

| legal_status = (UA): Rx-Only https://mozdocs.kiev.ua/likiview.php?id=33305 "Категорія відпуску. За рецептом."/"Leave Status: By Prescription"

| routes_of_administration = Oral

| bioavailability =

| metabolism = Hepatic

| elimination_half-life = ~87 hours

| excretion = Renal

| CAS_number_Ref =

| CAS_number = 129186-29-4

| ATC_prefix =

| ATC_suffix =

| PubChem = 121919

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = ?

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 108764

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XMJ87I93Y9

| C = 17

| H = 15

| Br = 1

| N = 4

| O = 2

| smiles = BrC1=CC2=C(C=C1)N(CC(NN)=O)C(CN=C2C3=CC=CC=C3)=O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H15BrN4O2/c18-12-6-7-14-13(8-12)17(11-4-2-1-3-5-11)20-9-16(24)22(14)10-15(23)21-19/h1-8H,9-10,19H2,(H,21,23)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XLGCMZLSEXRBSG-UHFFFAOYSA-N

| drug_name =

| alt =

| caption =

| type =

| MedlinePlus =

| licence_EU =

| pregnancy_AU =

| pregnancy_US =

| licence_US =

}}

Gidazepam, also known as hydazepam or hidazepam,{{cite book|author=Library of Congress|title=Library of Congress Subject Headings|url=https://books.google.com/books?id=p61dVgq963kC&pg=PA3300|year=2006|publisher=Library of Congress|pages=3300–}} is a drug which is an atypical benzodiazepine derivative, developed in the Soviet Union.{{cite journal | vauthors = Spasennikov BA, Spasennikova MG | title = [The new Soviet tranquilizer--gidazepam] | journal = Fel'dsher I Akusherka | volume = 56 | issue = 9 | pages = 35–7 | date = September 1991 | pmid = 1684941 }}{{cite journal | vauthors = Neznamov GG, Koshelev VV, Voronina TA, Trofimov SS | title = [Experimental and clinical rationale for complex treatment of mental disorders in clean-up workers of the Chernobyl nuclear plant accident] | journal = Eksperimental'naia i Klinicheskaia Farmakologiia | volume = 65 | issue = 2 | pages = 12–6 | date = Mar 2002 | pmid = 12109283 }} It is a selectively anxiolytic benzodiazepine.{{cite journal | vauthors = Korkhov VM, Tkachuk NA, Makan SY, Pavlovsky VI, Andronati SA | title = Affinities of gidazepam and its analogs for mitochondrial benzodiazepine receptors | journal = Journal of Receptor and Signal Transduction Research | volume = 22 | issue = 1–4 | pages = 411–20 | date = Feb 2002 | pmid = 12503630 | doi = 10.1081/RRS-120014610 | s2cid = 25403613 }} It also has therapeutic value in the management of certain cardiovascular disorders.{{cite journal | vauthors = Morozov IS, Barchukov VG, Neznamov GG | title = [The effect of gidazepam on the cardiovascular system function in patients with neurotic reactions and in healthy subjects under aggravated conditions] | journal = Eksperimental'naia i Klinicheskaia Farmakologiia | volume = 61 | issue = 1 | pages = 30–2 | date = Jan 1998 | pmid = 9575408 }}{{cite journal | vauthors = Petrova TR, Tatarkin AN | title = [The neuroregulatory modulation of the hemodynamic reactions to physical loading in patients with cardiac arrhythmias] | journal = Terapevticheskii Arkhiv | volume = 66 | issue = 9 | pages = 65–8 | year = 1994 | pmid = 7992218 }}{{cite journal | vauthors = Skibitskiĭ VV, Kanorskiĭ SG | title = [New pharmacodynamic effects of gidazepam and befol in patients with cardiac arrhythmias] | journal = Eksperimental'naia i Klinicheskaia Farmakologiia | volume = 56 | issue = 5 | pages = 23–7 | date = Sep 1993 | pmid = 7906171 }}{{cite journal | vauthors = Skibitskiĭ VV, Petrova TR, Kanorskiĭ SG | title = [Comparative analysis of antiarrhythmic action and electrophysiological effects of a new benzodiazepine derivative gidazepam and ethacizin in arrhythmias of various genesis] | journal = Kardiologiia | volume = 32 | issue = 6 | pages = 35–7 | date = June 1992 | pmid = 1405290 }}{{cite journal | vauthors = Meerson FZ, Skibitskiĭ VV | title = [Comparative anti-arrhythmia effectiveness of activators of body stress-limiting systems in patients with arrhythmia] | journal = Kardiologiia | volume = 32 | issue = 4 | pages = 25–30 | date = April 1992 | pmid = 1328745 }}