Girolline

{{Chembox

| ImageFile = Girolline.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = (1S,2S)-3-Amino-1-(2-amino-1H-imidazol-5-yl)-2-chloropropan-1-ol

| OtherNames = Giracodazole

|Section1={{Chembox Identifiers

| CASNo = 110883-46-0

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChEMBL = 1171272

| PubChem = 65911

| UNII = RU19QYB9WZ

| ChemSpiderID = 59320

| StdInChI=1S/C6H11ClN4O/c7-3(1-8)5(12)4-2-10-6(9)11-4/h2-3,5,12H,1,8H2,(H3,9,10,11)/t3-,5+/m0/s1

| StdInChIKey = YILCGOCHVFQMTC-WVZVXSGGSA-N

| SMILES = [C@H]([C@H](CN)Cl)(O)C=1NC(N)=NC1

}}

|Section2={{Chembox Properties

| C=6 | H=11 | Cl=1 | N=4 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Girolline (also known as giracodazole) is a chemical compound isolated from a marine sponge. It inhibits protein synthesis.{{cite journal | pmid = 24117378 | title = Unbiased Screening of Marine Sponge Extracts for Anti-inflammatory Agents Combined with Chemical Genomics Identifies Girolline as an Inhibitor of Protein Synthesis | date = 2014 | last1 = Fung | first1 = S. Y. | last2 = Sofiyev | first2 = V. | last3 = Schneiderman | first3 = J. | last4 = Hirschfeld | first4 = A. F. | last5 = Victor | first5 = R. E. | last6 = Woods | first6 = K. | last7 = Piotrowski | first7 = J. S. | last8 = Deshpande | first8 = R. | last9 = Li | first9 = S. C. | last10 = De Voogd | first10 = N. J. | last11 = Myers | first11 = C. L. | last12 = Boone | first12 = C. | last13 = Andersen | first13 = R. J. | last14 = Turvey | first14 = S. E. | journal = ACS Chemical Biology | volume = 9 | issue = 1 | pages = 247–257 | doi = 10.1021/cb400740c | pmc = 4371607 }}

References