Glabridin

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477396557

| ImageFile = Glabridin.svg

| IUPACName = (3R)-6′′,6′′-Dimethyl-6′′H-pyrano[2′′,3′′:7,8]isoflavan-2′,4′-diol

| SystematicName = 4-[(3R)-8,8-Dimethyl-3,4-dihydro-2H,8H-(benzo[1,2-b:3,4-b′]dipyran)-3-yl]benzene-1,3-diol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 59870-68-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HOC5567T41

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 480477

| PubChem = 124052

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 110560

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 5369

| SMILES = O4c2c1\C=C/C(Oc1ccc2C[C@H](c3ccc(O)cc3O)C4)(C)C

| InChI = 1/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1

| InChIKey = LBQIJVLKGVZRIW-ZDUSSCGKBA

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LBQIJVLKGVZRIW-ZDUSSCGKSA-N

}}

|Section2={{Chembox Properties

| C=20 | H=20 | O=4

| Appearance = Yellowish-brown powder

| Density =

| MeltingPtC = 238-240

| MeltingPt_ref = SciFinder Record for CAS#59870-68-7

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Glabridin is a chemical compound that is found in the root extract of licorice (Glycyrrhiza glabra).{{Cite journal | vauthors = Kinoshita T, Kajiyama K, Hiraga Y, Takahashi K, Tamura Y, Mizutani K | journal = Heterocycles | title = Isoflavan derivatives from Glycyrrhiza glabra (licorice) | date = 1996 | volume = 43 | issue = 3 | pages = 581–588}} Glabridin is an isoflavane, a type of isoflavonoid. This product is part of a larger family of plant-derived molecules, the natural phenols. Glabridin effectively inhibits platelet activation, so it might become therapeutic agent for thromboembolic disorders.{{cite journal | vauthors = Chung CL, Chen JH, Huang WC, Sheu JR, Hsia CW, Jayakumar T, Hsia CH, Chiou KR, Hou SM | title = Glabridin, a Bioactive Flavonoid from Licorice, Effectively Inhibits Platelet Activation in Humans and Mice | journal = International Journal of Molecular Sciences | volume = 23 | issue = 19 | date = September 2022 | page = 11372 | pmid = 36232674| pmc = 9570097 | doi = 10.3390/ijms231911372 | doi-access = free }}{{Creative Commons text attribution notice|cc=by4|from this source=yes}}

It is used as an ingredient in cosmetics and is listed in International Nomenclature of Cosmetic Ingredients (INCI).

Glabridin is yellowish-brown powder. It is insoluble in water, but soluble in organic solvents such as propylene glycol.