Gliquidone

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 443836120

| IUPAC_name = 1-cyclohexyl-3-[4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]phenyl]sulfonylurea

| image = Gliquidone.svg

| width = 275

| tradename = Glurenorm

| Drugs.com = {{drugs.com|international|gliquidone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category = C

| legal_AU =

| legal_CA =

| legal_UK = POM

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Oral (tablets)

| bioavailability = High (T_max = 2–3 hours)

| protein_bound =

| metabolism = Extensive hepatic

| onset = 1–1.5 hours

| elimination_half-life =

| excretion = Biliary (95%), renal (5%)

| CAS_number = 33342-05-1

| ATC_prefix = A10

| ATC_suffix = BB08

| PubChem = 91610

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01251

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 82719

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = C7C2QDD75P

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02430

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 383634

| C=27 | H=33 | N=3 | O=6 | S=1

| smiles = O=C(NC1CCCCC1)NS(=O)(=O)c2ccc(cc2)CCN4C(=O)c3c(ccc(OC)c3)C(C4=O)(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C27H33N3O6S/c1-27(2)23-14-11-20(36-3)17-22(23)24(31)30(25(27)32)16-15-18-9-12-21(13-10-18)37(34,35)29-26(33)28-19-7-5-4-6-8-19/h9-14,17,19H,4-8,15-16H2,1-3H3,(H2,28,29,33)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LLJFMFZYVVLQKT-UHFFFAOYSA-N

}}

Gliquidone (INN, sold under the trade name Glurenorm) is an anti-diabetic medication in the sulfonylurea class.{{cite journal | vauthors = Malaisse WJ | title = Gliquidone contributes to improvement of type 2 diabetes mellitus management: a review of pharmacokinetic and clinical trial data | journal = Drugs in R&D | volume = 7 | issue = 6 | pages = 331–7 | date = 2006 | pmid = 17073516 | doi = 10.2165/00126839-200607060-00002 | s2cid = 10155445 }} It is classified as a second-generation sulfonylurea. It is used in the treatment of diabetes mellitus type 2. It is marketed by the pharmaceutical company Boehringer Ingelheim (Germany).