Glyceryl diacetate

{{Chembox

| ImageFileL1 = 1,2-glyceryl diacetate.svg

| ImageSizeL1 = 90px

| ImageCaptionL1 = 1,2-glyceryl diacetate

| ImageFileR1 = 1,3-glyceryl diacetate.svg

| ImageSizeR1 = 120px

| ImageCaptionR1 = 1,3-glyceryl diacetate

| OtherNames = Diacetin; Glycerol diacetate

|Section1={{Chembox Identifiers

| ChemSpiderID = 59412

| ChemSpiderID_Comment = (1,2)

| ChemSpiderID1 = 60286

| ChemSpiderID1_Comment = (1,3)

| PubChem = 66021

| PubChem_Comment = (1,2)

| PubChem1 = 66924

| PubChem1_Comment = (1,3)

| CASNo = 25395-31-7

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo_Comment = (mixture)

| CASNo1 = 102-62-5

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1_Comment = (1,2)

| CASNo2 = 105-70-4

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2_Comment = (1,3)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GJ0544W99Q

| UNII_Comment = (mixture)

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = 9W955270ZW

| UNII1_Comment = (1,2)

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = G45CU3Z186

| UNII2_Comment = (1,3)

| RTECS = AK3325000

| EC_number = 246-941-2

| StdInChI=1S/C7H12O5/c1-5(9)11-4-7(3-8)12-6(2)10/h7-8H,3-4H2,1-2H3

| StdInChIKey = UXDDRFCJKNROTO-UHFFFAOYSA-N

| SMILES = CC(=O)OCC(CO)OC(=O)C

}}

|Section2={{Chembox Properties

|C=7|H=12|O=5

|MeltingPtC=−30

|BoilingPtC=280

}}

}}

Glyceryl diacetate is a food additive with the E number E1517.{{cite web |title=Call for food additives usage level and/or concentration data in food and beverages intended for human consumption (Batch 7) |url=https://www.efsa.europa.eu/en/consultations/call/180122 |publisher=EFSA |accessdate=1 October 2018}}

This diglyceride is more generally known as diacetin. It is the diester of glycerol and acetylating agents, such as acetic acid and acetic anhydride.{{cite journal | last1 = Kong | first1 = P. S. | last2 = Aroua | first2 = M. K. | last3 = Daud | first3 = W. M. A. W. | last4 = Lee | first4 = H. V. | last5 = Cognet | first5 = P. | last6 = Peres | first6 = Y. | year = 2016 | title = Catalytic role of solid acid catalysts in glycerol acetylation for the production of bio-additives: a review | url = https://www.researchgate.net/publication/304528567 | journal = RSC Advances | volume = 6 | issue = 73| pages = 68885–68905 | doi = 10.1039/C6RA10686B | bibcode = 2016RSCAd...668885K | s2cid = 102384754 }} It is a colorless, viscous and odorless liquid with a high boiling point. Glycerol diacetate is typically a mixture of two isomers, 1,2-glyceryl diacetate and 1,3-glyceryl diacetate.{{GESTIS|ZVG=490649}}