HPTE

{{chembox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| ImageFile = 2,2-bis(p-hydroxyphenyl)-1,1,1-trichloroethane.svg

| ImageSize = 250px

| ImageAlt =

| ImageFile1 =

| ImageSize1 =

| ImageAlt1 =

| PIN = 4,4′-(2,2,2-Trichloroethane-1,1-diyl)diphenol

| OtherNames = p,p'-Hydroxy-DDT
Hydroxychlor
2,2-bis(p-hydroxyphenyl)-1,1,1-trichloroethane
1,1,1-Trichloro-2,2-bis(4-hydroxyphenyl)ethane

|Section1={{Chembox Identifiers

| Abbreviations =

| ChemSpiderID_Ref =

| ChemSpiderID = 68781

| Beilstein = 2054671

| DTXSID = DTXSID8022325

| EINECS = 623-854-1

| UNII_Ref =

| UNII = H58165YO91

| KEGG_Ref =

| KEGG = C14136

| InChI = 1S/C14H11Cl3O2/c15-14(16,17)13(9-1-5-11(18)6-2-9)10-3-7-12(19)8-4-10/h1-8,13,18-19H

| InChIKey = IUGDILGOLSSKNE-UHFFFAOYSA-N

| ChEMBL_Ref =

| ChEMBL = 196585

| StdInChI_Ref =

| StdInChI = 1S/C14H11Cl3O2/c15-14(16,17)13(9-1-5-11(18)6-2-9)10-3-7-12(19)8-4-10/h1-8,13,18-19H

| StdInChIKey_Ref =

| StdInChIKey = IUGDILGOLSSKNE-UHFFFAOYSA-N

| CASNo = 2971-36-0

| CASNo_Ref =

| PubChem = 76302

| ChEBI_Ref =

| ChEBI = 34025

| SMILES = C1=CC(=CC=C1C(C2=CC=C(C=C2)O)C(Cl)(Cl)Cl)O

}}

|Section2={{Chembox Properties

| C=14 | H=11 | Cl=3 | O=2

| MolarMass =

| Appearance =

| Odor =

| Density =

| MeltingPtC =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| PEL =

| IDLH =

| REL =

| LD50 =

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

}}

}}

HPTE, also known as hydroxychlor, p,p'-hydroxy-DDT, or 2,2-bis(4-hydroxyphenyl)-1,1,1-trichloroethane, is a metabolite of methoxychlor, a synthetic insecticide related to DDT.{{cite journal |last1=Leung-Gurung |first1=Lucie |last2=Escalante Cobb |first2=Priscilla |last3=Mourad |first3=Faraj |last4=Zambrano |first4=Cristina |last5=Muscato |first5=Zachary |last6=Sanchez |first6=Victoria |last7=Godde |first7=Kanya |last8=Broussard |first8=Christine |title=Methoxychlor metabolite HPTE alters viability and differentiation of embryonic thymocytes from C57BL/6 mice |journal=Journal of Immunotoxicology |date=4 July 2018 |volume=15 |issue=1 |pages=104–118 |doi=10.1080/1547691X.2018.1474978|pmid=29973080 |pmc=6120686 |doi-access=free }} Like bisphenol A with similar chemical structure, HPTE is an endocrine disruptor which has estrogenic activity,{{cite journal |last1=Hewitt |first1=Sylvia C. |last2=Korach |first2=Kenneth S. |title=Estrogenic Activity of Bisphenol A and 2,2-bis(p-Hydroxyphenyl)-1,1,1-trichloroethane (HPTE) Demonstrated in Mouse Uterine Gene Profiles |journal=Environmental Health Perspectives |date=January 2011 |volume=119 |issue=1 |pages=63–70 |doi=10.1289/EHP.1002347|pmid=20826375 |pmc=3018502 |bibcode=2011EnvHP.119...63H }} and also inhibits Cholesterol side-chain cleavage enzyme (P450scc, CYP11A1){{cite journal |last1=Akgul |first1=Yucel |last2=Derk |first2=Raymond C. |last3=Meighan |first3=Terence |last4=Rao |first4=K. Murali Krishna |last5=Murono |first5=Eisuke P. |title=The methoxychlor metabolite, HPTE, inhibits rat luteal cell progesterone production |journal=Reproductive Toxicology |date=July 2011 |volume=32 |issue=1 |pages=77–84 |doi=10.1016/J.REPROTOX.2011.05.013|pmid=21664964 |bibcode=2011RepTx..32...77A }} and 3α-hydroxysteroid dehydrogenase (3α-HSD).{{cite journal |last1=Mao |first1=Baiping |last2=Wu |first2=Chengyun |last3=Zheng |first3=Wenwen |last4=Shen |first4=Qiuxia |last5=Wang |first5=Yiyan |last6=Wang |first6=Qiufan |last7=Lin |first7=Han |last8=Li |first8=Xiaoheng |last9=Sun |first9=Jianliang |last10=Ge |first10=Ren-Shan |title=Methoxychlor and its metabolite HPTE inhibit rat neurosteroidogenic 3α-hydroxysteroid dehydrogenase and retinol dehydrogenase 2 |journal=Neuroscience Letters |date=September 2018 |volume=684 |pages=169–174 |doi=10.1016/j.neulet.2018.08.008|pmid=30107201 |s2cid=52004606 }}