HPTP

{{Short description|Monoaminergic neurotoxin}}

{{Infobox drug

| drug_name =

| image = HPTP.svg

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Serotonergic and dopaminergic neurotoxin

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 52669-92-8

| CAS_supplemental =

| PubChem = 171187

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 149659

| UNII =

| KEGG =

| ChEBI = 177523

| ChEMBL = 3544895

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = 4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-1-(4-fluorophenyl)butan-1-one

| C=21 | H=21 | Cl=1 | F=1 | N=1 | O=1

| SMILES = C1CN(CC=C1C2=CC=C(C=C2)Cl)CCCC(=O)C3=CC=C(C=C3)F

| StdInChI = 1S/C21H21ClFNO/c22-19-7-3-16(4-8-19)17-11-14-24(15-12-17)13-1-2-21(25)18-5-9-20(23)10-6-18/h3-11H,1-2,12-15H2

| StdInChIKey = ZNOLNAPJKOYTHY-UHFFFAOYSA-N

}}

HPTP is a monoaminergic neurotoxin related to MPTP.{{cite book | vauthors = Kostrzewa RM | title=Handbook of Neurotoxicity | chapter=Survey of Selective Monoaminergic Neurotoxins Targeting Dopaminergic, Noradrenergic, and Serotoninergic Neurons | publisher=Springer International Publishing | publication-place=Cham | date=2022 | isbn=978-3-031-15079-1 | doi=10.1007/978-3-031-15080-7_53 | pages=159–198}}{{cite journal | last=Igarashi | first=Kazuo | title=The Possible Role of an Active Metabolite Derived from the Neuroleptic Agent Haloperidol in Drug-Induced Parkinsonism | journal=Journal of Toxicology: Toxin Reviews | volume=17 | issue=1 | date=1998 | issn=0731-3837 | doi=10.3109/15569549809006488 | pages=27–38}}{{cite journal | vauthors = Górska A, Marszałł M, Sloderbach A | title = [The neurotoxicity of pyridinium metabolites of haloperidol] | language = Polish | journal = Postepy Higieny I Medycyny Doswiadczalnej | volume = 69 | issue = | pages = 1169–1175 | date = October 2015 | pmid = 26561842 | doi = 10.5604/17322693.1175009 | doi-broken-date = 1 November 2024 | trans-title = The neurotoxicity of pyridinium metabolites of haloperidol | doi-access = free }}{{cite journal | vauthors = Castagnoli N, Castagnoli KP, Van der Schyf CJ, Usuki E, Igarashi K, Steyn SJ, Riker RR | title = Enzyme-catalyzed bioactivation of cyclic tertiary amines to form potential neurotoxins | journal = Pol J Pharmacol | volume = 51 | issue = 1 | pages = 31–38 | date = 1999 | pmid = 10389142 | doi = | url = }} It is the dehydration product of haloperidol. The agent is specifically a dopaminergic and serotonergic neurotoxin. HPTP is a prodrug of HPP⁺, which mediates its monoaminergic neurotoxicity. This is analogous to how MPP⁺ mediates the neurotoxicity of MPTP. Other related compounds include RHPTP and RHPP⁺.{{cite journal | vauthors = Avent KM, DeVoss JJ, Gillam EM | title = Cytochrome P450-mediated metabolism of haloperidol and reduced haloperidol to pyridinium metabolites | journal = Chem Res Toxicol | volume = 19 | issue = 7 | pages = 914–920 | date = July 2006 | pmid = 16841959 | doi = 10.1021/tx0600090 | url = }}