HT-2157

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-Phenyl-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one

| image = HT-2157_formula_skeletal.svg

| alt = Structural formula

| width = 210

| image2 = HT-2157 molecule spacefill.png

| alt2 = Space-filling model

| width2 = 190

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 6126

| CAS_number = 303149-14-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J4DRJ9BFS1

| ATC_prefix = none

| ATC_suffix =

| PubChem = 1471834

| ChemSpiderID = 1213983

| C=21 | H=13 | F=3 | N=2 | O=1

| smiles = c14ccccc4n(-c3ccccc3)c(=O)c1=N\c(c2)cccc2C(F)(F)F

| StdInChI = 1S/C21H13F3N2O/c22-21(23,24)14-7-6-8-15(13-14)25-19-17-11-4-5-12-18(17)26(20(19)27)16-9-2-1-3-10-16/h1-13H/b25-19+

| StdInChIKey = TXCGMRVPXUBHAL-NCELDCMTSA-N

}}

HT-2157 (former development code SNAP-37889) is a drug which acts as a selective non-peptide antagonist for the receptor GAL-3, which is usually activated by the neuropeptide galanin. Blocking this receptor with HT-2157 produced increased serotonin release,{{Cite web|url=http://www.pa2online.org/abstract/abstract.jsp?abid=28301|title=pA2 Online|website=www.pa2online.org}} as well as producing antidepressant and anxiolytic effects in animal studies,{{cite journal | vauthors = Swanson CJ, Blackburn TP, Zhang X, Zheng K, Xu ZQ, Hökfelt T, Wolinsky TD, Konkel MJ, Chen H, Zhong H, Walker MW, Craig DA, Gerald CP, Branchek TA | display-authors = 6 | title = Anxiolytic- and antidepressant-like profiles of the galanin-3 receptor (Gal3) antagonists SNAP 37889 and SNAP 398299 | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 102 | issue = 48 | pages = 17489–94 | date = November 2005 | pmid = 16287967 | pmc = 1283534 | doi = 10.1073/pnas.0508970102 | doi-access = free }} and it was also being researched for treatment of cognitive dysfunction.{{Cite patent | inventor = Kaplan AP | title = Enteric-coated HT-2157 compositions and methods of their use | country = US | number = 8277842 | pubdate = January 20, 2012 }} All human clinical trials were terminated due to safety concerns however, and new GAL-3 antagonists are now being sought instead.{{Cite web|url=http://www.dartneuroscience.com/DrugPrograms.php|title=Dart NeuroScience LLC -- Scientific Advisory Board|website=www.dartneuroscience.com}}

References