Halcinonide
{{Short description|Chemical compound}}
{{for|Halog, the capital of the former Indian Princely State|Dhami State}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 377859727
| image = Halcinonide.svg
| width = 220
| tradename = Halog
| Drugs.com = {{drugs.com|CONS|halcinonide}}
| MedlinePlus = a682272
| pregnancy_AU =
| pregnancy_category =
| routes_of_administration = Topical
| ATC_prefix = D07
| ATC_suffix = AD02
| legal_AU =
| legal_UK =
| legal_US = Rx-only
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 3093-35-4
| PubChem = 443943
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB06786
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 391997
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = SI86V6QNEG
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200845
| IUPAC_name = (4aS,4bR,5S,6aS,6bS,9aR,10aS,10bS)-6b-(chloroacetyl)-4b-fluoro-5-hydroxy-4a,6a,8,8-tetramethyl-3,4,4a,4b,5,6,6a,6b,9a,10,10a,10b,11,12-tetradecahydro-2H-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-2-one
| C=24 | H=32 | Cl=1 | F=1 | O=5
| smiles = ClCC(=O)[C@]45OC(O[C@@H]5C[C@@H]2[C@@]4(C[C@H](O)[C@]3(F)[C@@]1(/C(=C\C(=O)CC1)CC[C@@H]23)C)C)(C)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C24H32ClFO5/c1-20(2)30-19-10-16-15-6-5-13-9-14(27)7-8-21(13,3)23(15,26)17(28)11-22(16,4)24(19,31-20)18(29)12-25/h9,15-17,19,28H,5-8,10-12H2,1-4H3/t15-,16-,17-,19+,21-,22-,23-,24+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = MUQNGPZZQDCDFT-JNQJZLCISA-N
}}
Halcinonide is a high potency corticosteroid, in group II (second most potent group) under US classification.{{cite journal |vauthors=Pujos E, Flament-Waton MM, Paisse O, Grenier-Loustalot MF |title=Comparison of the analysis of corticosteroids using different techniques |journal=Anal Bioanal Chem |volume=381 |issue=1 |pages=244–54 |date=January 2005 |pmid=15700162 |doi=10.1007/s00216-004-2890-9|s2cid=19561444 }} It is used topically (in a 0.05% cream provided as Halog) in the treatment of certain skin conditions. It is available as a generic medication.{{cite web | title=First Generic Drug Approvals | website=U.S. Food and Drug Administration (FDA) | date=8 July 2024 | url=https://www.fda.gov/drugs/drug-and-biologic-approval-and-ind-activity-reports/first-generic-drug-approvals | access-date=9 July 2024}}
References
{{Reflist}}
{{Glucocorticoids}}
{{Glucocorticoidics}}
Category:Corticosteroid cyclic ketals
{{dermatologic-drug-stub}}