Halometasone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = changed

| IUPAC_name = (6α,11β,16α)-2-Chloro-6,9-difluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione

| image2 = Halometasone cream.jpg

| width = 200

| image = Halometasone.png

| width2 = 200

| tradename = Sicorten

| Drugs.com = {{drugs.com|international|halometasone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Topical

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 50629-82-8

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1587228

| ATC_prefix = D07

| ATC_suffix = AC12

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J69Z9UU41Z

| PubChem = 9846332

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8022046

| smiles = O=C(CO)[C@]3(O)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)C(\Cl)=C\1)[C@@H](F)C[C@H]4[C@@H]2C[C@H]3C)C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C22H27ClF2O5/c1-10-4-11-12-5-15(24)13-6-16(27)14(23)7-19(13,2)21(12,25)17(28)8-20(11,3)22(10,30)18(29)9-26/h6-7,10-12,15,17,26,28,30H,4-5,8-9H2,1-3H3/t10-,11+,12+,15+,17+,19+,20+,21+,22+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = GGXMRPUKBWXVHE-MIHLVHIWSA-N

| C=22 | H=27 | Cl=1 | F=2 | O=5

| synonyms = (6S,8S,9R,10S,11S,13S,16R,17R)-2-chloro-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxy-acetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one

}}

Halometasone is a potent (Group III) synthetic tri-halogenated corticosteroid for topical application possessing pronounced anti-inflammatory, antiexudative, antiepidermoplastic, antiallergic, and antipruritic properties. It has been approved in many European countries including Spain, Germany, Switzerland, Austria, Netherlands, Belgium, and Portugal and other regions such as China, Hong Kong, Turkey, Israel, South Africa and India.

It has been used to treat chronic psoriasis vulgaris{{cite journal | vauthors = Galbiati G, Bonfacini V, Candiani F | title = Halometasone cream by day and halometasone ointment at night for the treatment of patients with chronic psoriasis vulgaris | journal = The Journal of International Medical Research | volume = 11 | pages = 31–3 | year = 1983 | issue = Suppl 1 | pmid = 6339290 }} and non-infected acute eczematous dermatoses (eczema).{{cite journal | vauthors = Yawalkar SJ, Macarol V, Montanari C | title = An overview of international clinical trials with halometasone cream | journal = The Journal of International Medical Research | volume = 11 | pages = 1–7 | year = 1983 | issue = Suppl 1 | pmid = 6339286 }} One study demonstrated that 0.05% halometasone cream was more effective than 0.05% betamethasone cream in treating dermatitis, though both were well tolerated, with no systemic adverse effects reported.{{cite journal | vauthors = Schuppli R, Dressler H, Yawalkar SJ, Weirich EG | title = [Comparative clinical trial of a new trihalogenated dermatocorticoid (halometasone) versus betamethasone dipropionate] | journal = Zeitschrift für Hautkrankheiten | volume = 58 | issue = 4 | pages = 230–7 | date = February 1983 | pmid = 6342285 }}

References

{{Reflist|2}}

{{Glucocorticoids}}

{{Glucocorticoidics}}

Category:Corticosteroids

Category:Organochlorides

Category:Organofluorides