Hasubanan

{{chembox

| Watchedfields = changed

| verifiedrevid = 443854062

| ImageFile = Hasubanan.svg

| ImageSize = 120px

| IUPACName = (3aS-cis)-2,3,4,5-Tetrahydro-3a,9b-butano-1H-benz[e]indole

| OtherNames =

|Section1={{Chembox Identifiers

| InChI = 1/C16H21N/c1-2-6-14-13(5-1)7-10-16-9-4-3-8-15(14,16)11-12-17-16/h1-2,5-6,17H,3-4,7-12H2/t15-,16+/m1/s1

| InChIKey = RKWPQIQYRNOTMT-CVEARBPZBP

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H21N/c1-2-6-14-13(5-1)7-10-16-9-4-3-8-15(14,16)11-12-17-16/h1-2,5-6,17H,3-4,7-12H2/t15-,16+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RKWPQIQYRNOTMT-CVEARBPZSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 14510-67-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8K38RGP7SY

| PubChem = 6857499

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID=20152973

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 35647

| SMILES = C2C[C@]14CCCC[C@@]4(CCN1)c3ccccc23

}}

|Section2={{Chembox Properties

| C=16

| H=21

| N=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Hasubanan is an alkaloid with the chemical formula of C₁₆H₂₁N. It forms the central core of a class of alkaloids known collectively as hasubanans.{{cite journal | author = Zhang H, Yue J | title = Hasubanan type alkaloids from Stephania longa | journal = J Nat Prod | volume = 68 | issue = 8 | pages = 1201–7 | year = 2005 | pmid = 16124761 | doi = 10.1021/np0500833}} The compound is derived from reticuline, as is morphinan, but is comparatively more oxidized and rearranged. It is similar to acutumine.

Various alkaloids of this family have been synthesized in the laboratories.{{Cite journal |last1=Ikonnikova |first1=Viktoria A. |last2=Baranov |first2=Mikhail S. |last3=Mikhaylov |first3=Andrey A. |date=2022-07-18 |title=Developments in the Synthesis of Hasubanan Alkaloids |url=https://onlinelibrary.wiley.com/doi/10.1002/ejoc.202200675 |journal=European Journal of Organic Chemistry |volume=2022 |issue=31 |language=en |pages=ejoc.202200675 |doi=10.1002/ejoc.202200675 |s2cid=250661115 |issn=1434-193X|url-access=subscription }}