Heptabarb
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 443853293
| IUPAC_name = 5-cyclohept-1-en-1-yl-5-ethylpyrimidine-2,4,6(1H,3H,5H)-trione
| image = Heptabarbital structure.svg
| width = 135
| tradename =
| pregnancy_category =
| legal_status =
| legal_CA = Schedule IV
| metabolism = Hepatic
| elimination_half-life = 6.1-11.2 hours
| excretion = Renal
| CAS_number = 509-86-4
| ATC_prefix = N05
| ATC_suffix = CA11
| PubChem = 10518
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01354
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10081
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = V10R70ML23
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C17725
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 468837
| synonyms = G-475
| C=13 | H=18 | N=2 | O=3
| smiles = O=C1NC(=O)NC(=O)C1(/C2=C/CCCCC2)CC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H18N2O3/c1-2-13(9-7-5-3-4-6-8-9)10(16)14-12(18)15-11(13)17/h7H,2-6,8H2,1H3,(H2,14,15,16,17,18)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PAZQYDJGLKSCSI-UHFFFAOYSA-N
}}
Heptabarb (INN; Eudan, Medapan, Medomin, Noctyn), also known as heptabarbitone (BAN) or heptabarbital, is a sedative and hypnotic drug of the barbiturate family.{{cite book | vauthors = Ganellin CR, Triggle DJ, Macdonald F | title = Dictionary of pharmacological agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1003 | access-date = 26 November 2011 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1003}}{{cite book | title = Index nominum 2000: international drug directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA513 | access-date = 26 November 2011 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | page = 513}} It was used in Europe for the treatment of insomnia from the 1950s onwards, but has since been discontinued.
See also
References
{{Reflist}}
{{Hypnotics and sedatives}}
{{GABAAR PAMs}}
{{sedative-stub}}