Hexaconazole

{{Chembox

| Watchedfields = changed

| ImageFile = Hexaconazole Structural Formula V.1.svg

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageSize = 244

| ImageName = Kekulé, skeletal formula of hexaconazole

| SystematicName = 2-(2,4-Dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 79983-71-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = SX9R3X1FQV

| PubChem = 66461

| PubChem1 = 37888330

| PubChem1_Comment = (R)

| PubChem2 = 37888329

| PubChem2_Comment = (S)

| ChemSpiderID = 59833

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID1 = 21173802

| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID1_Comment = (S)

| EINECS = 413-050-7

| UNNumber = 3077

| KEGG = C18466

| KEGG_Ref = {{keggcite|correct|kegg}}

| MeSHName = Hexaconazole

| RTECS = XZ4803200

| Beilstein = 8328399

| SMILES = CCCCC(O)(Cn1cncn1)c1ccc(Cl)cc1Cl

| SMILES1 = CCCCC(O)(CN1C=NC=N1)C1=CC=C(Cl)C=C1Cl

| StdInChI = 1S/C14H17Cl2N3O/c1-2-3-6-14(20,8-19-10-17-9-18-19)12-5-4-11(15)7-13(12)16/h4-5,7,9-10,20H,2-3,6,8H2,1H3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = STMIIPIFODONDC-UHFFFAOYSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

}}

|Section2={{Chembox Properties

| Properties_ref =[http://www.farmchemicalsinternational.com/cropprotection/cpd/?op=cpdproductdetail&pid=211180 Hexaconazole], Crop Protection Dictionary, Farm Chemicals International

| C=14 | N=3 | H=17 | O=1 | Cl=2

| Appearance = White crystalline solid

| MeltingPtC = 111

}}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS exclamation mark}} {{GHS environment}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302|317|411}}

| PPhrases = {{P-phrases|273|280}}

| LD50 = 6071 mg/kg (oral, female rat)

}}

}}

Hexaconazole is a broad-spectrum systemic triazole fungicide used for the control of many fungi particularly Ascomycetes and Basidiomycetes. Major consumption is in Asian countries and it is used mainly for the control of rice sheath blight in China, India, Vietnam, and parts of East Asia. It is also used for control of diseases in various fruits and vegetables.{{cn|date=December 2022}}