Hexetidine

{{Short description|Anti-bacterial agent}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447134056

| IUPAC_name = 1,3-bis(2-ethylhexyl)-5-methylhexahydropyrimidin-5-amine

| image = Hexetidine.svg

| tradename = Bactidol, others

| Drugs.com = {{drugs.com|international|hexetidine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category = Not to be used by pregnant women

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = OTC

| routes_of_administration = Topical (mouthwash)

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 141-94-6

| ATC_prefix = A01

| ATC_suffix = AB12

| ATC_supplemental = {{ATC|G01|AX16}}

| PubChem = 3607

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB08958

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 852A84Y8LS

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 144673

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 32697287

| C=21 | H=45 | N=3

| smiles = CCCCC(CC)CN1CC(CN(C1)CC(CC)CCCC)(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C22H46N2/c1-7-11-13-20(9-3)15-23-17-22(5,6)18-24(19-23)16-21(10-4)14-12-8-2/h20-21H,7-19H2,1-6H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZSHBZCXOMHHPCE-UHFFFAOYSA-N

}}

Hexetidine is an anti-bacterial and anti-fungal agent commonly used in both veterinary and human medicine. It is a local anesthetic, astringent and deodorant and has antiplaque effects.{{cite journal |vauthors=Kapić E, Becić F, Becić E |title=Hexetidine--an oral antiseptic |journal=Med Arh |volume=56 |issue=1 |pages=43–8 |year=2002 |pmid=11917691}}

Hexetidine is the medicinal ingredient in Sterisol, which is labelled for the symptomatic treatment of: streptococcal pharyngitis ('strep throat'), tonsillitis, pharyngitis, laryngitis, gingivitis, ulcerative stomatitis, oral thrush and Vincent's angina; postoperative hygiene following tonsillectomy, throat or oral surgery. Hexetidine is not the same as Chlorhexidine, another chemical commonly used in mouthwash, or the antimicrobial drug Hexedene (C₂₂H₄₅N₃).{{cite web | url=https://www.simsonpharma.com/product/hexedine | title=Hexedine | CAS No- 5980-31-4 | Simson Pharma Limited }}

In the UK, hexetidine is the active ingredient in the medicated mouthwash branded Oraldene. In Canada, hexetidine was the active ingredient in the medicated mouthwash branded Steri/sol which has been discontinued. It used to be produced by McNeil Consumer Healthcare, a division of Johnson & Johnson (originally Warner–Lambert, then marketed by Pfizer after its acquisition since 2007). Oraldene contains 0.1 g/100 ml of hexetidine. In some European countries, the gargle solution and mouth spray in bottles of 40 ml named Hexoral (by Mcneil) also contains 0.2% hexetidine as its active compound. In Greece it is called Hexalen mouth wash{{Cite web|url=https://www.galinos.gr/web/drugs/main/packages/7542|title=Γαληνός - Σκεύασμα - HEXALEN MOUTH.WASH 0,1% W/V FL x 200 ML (Γυάλινο φιαλίδιο) - Γενικά}} (also available in spray). Hexetidine can also be found in the mouthwash Bactidol (by Mcneil) which is sold in many Asian countries. In Germany, hexetidine vaginal suppositories branded Vagi-Hex are available to be used for vaginal antisepsis. They are also used in late pregnancy for reducing neonatal infectious mortality and morbidity due to group B streptococcal infections;{{cite journal |vauthors=Weidinger H, Passloer HJ, Kovacs L, Berle B | title = [The advantage of preventive vaginal antisepsis with hexetidine in obstetrics and gynecology] | language = German | journal = Geburtshilfe Frauenheilkd | volume = 51 | issue = 11 | pages = 929–35 |date=November 1991 | pmid = 1773929 | doi = 10.1055/s-2008-1026238 }} nonetheless, hexetidine is to be used with care during pregnancy, and its vaginal use is counter-indicated in the first three months of pregnancy.[http://medikamente.onmeda.de/Medikament/Vagi-Hex/med_gegenanzeigen-medikament-10.html Vagi-Hex: Gegenanzeigen] (Vagi-Hex: Counterindications, in German language)

Image:Hexetidine.png