Hexolame

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8R,9S,13S,14S,17S)-17-(6-Hydroxyhexylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol

| image = Hexolame.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 110346-23-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ESL7LZ0FOL

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 196635

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 170347

| KEGG =

| ChEBI =

| ChEMBL =

| C=24 | H=37 | N=1 | O=2

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2NCCCCCCO)CCC4=C3C=CC(=C4)O

| StdInChI_Ref =

| StdInChI = 1S/C24H37NO2/c1-24-13-12-20-19-9-7-18(27)16-17(19)6-8-21(20)22(24)10-11-23(24)25-14-4-2-3-5-15-26/h7,9,16,20-23,25-27H,2-6,8,10-15H2,1H3/t20-,21-,22+,23+,24+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = DPRSBWGNESQTLG-DJCPXJLLSA-N

| synonyms = 17β-((6-Hydroxyhexyl)amino)estradiol; 17β-[(6-Hydroxyhexyl)amino]estra-1,3,5(10)-trien-3-ol; N-(3-Hydroxy-1,3,5(10)-estratrien 17-yl)-6-hydroxyhexylamine

}}

Hexolame, also known as 17β-((6-hydroxyhexyl)amino)estradiol, is a synthetic, steroidal estrogen and a 17β-aminoestrogen with anticoagulant effects that was first described in 1990 and was never marketed.{{cite book | vauthors = Negwer M, Scharnow HG |title=Organic-chemical drugs and their synonyms: (an international survey)|url=https://books.google.com/books?id=1nBqAAAAMAAJ|year=2001|publisher=Wiley-VCH|isbn=978-3-527-30247-5|page=12610}}{{cite journal | vauthors = Rubio-Póo C, Lemini C, García-Mondragón J, de la Peña A, Jayme V, Mendoza-Patiño N, Zavala E, Silva G, Blickenstaff RT, Fernández JM | display-authors = 6 | title = The anticoagulant effect of hexolame, N-(3-hydroxy-1,3,5(10)-estratrien-17 beta-yl)-6-hydroxyhexylamine, another amino-estrogen with prolonged anticoagulant effect | journal = Steroids | volume = 55 | issue = 2 | pages = 83–86 | date = February 1990 | pmid = 2326832 | doi = 10.1016/0039-128x(90)90030-f | s2cid = 32937513 }}{{cite journal | vauthors = Rubio-Póo C, Lemini C, Silva G, García-Mondragón J, Zavala E, Castro D, Mendoza-Patiño N, Mandoki JJ | display-authors = 6 | title = Comparison of the time course of anticoagulant and estrogenic effects of prolame, butolame, pentolame and hexolame, a homologous series of 17 beta-amino estrogens | journal = Proceedings of the Western Pharmacology Society | volume = 36 | pages = 143–147 | year = 1993 | pmid = 8378368 }}