Homodihydrocapsaicin

{{chembox

|Verifiedfields = changed

|Watchedfields = changed

|verifiedrevid = 424868550

|ImageFile = Homodihydrocapsaicin.svg

|ImageSize = 250px

|PIN = N-[(4-Hydroxy-3-methoxyphenyl)methyl]-9-methyldecanamide

|OtherNames = {{bulletedlist|Homodihydrocapsaicin|N-Vanillyl-9-methyldecanamide|Vanillylamide of 9-methyldecanoic acid|HDHC}}

|Section1={{Chembox Identifiers

|CASNo_Ref = {{cascite|correct|CAS}}

|CASNo = 20279-06-5

|UNII_Ref = {{fdacite|correct|FDA}}

|UNII = QE35S0T20Z

|PubChem = 3084336

|ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

|ChemSpiderID = 2341417

|SMILES = O=C(NCc1cc(OC)c(O)cc1)CCCCCCCC(C)C

|InChI = 1/C19H31NO3/c1-15(2)9-7-5-4-6-8-10-19(22)20-14-16-11-12-17(21)18(13-16)23-3/h11-13,15,21H,4-10,14H2,1-3H3,(H,20,22)

|InChIKey = AKDLSISGGARWFP-UHFFFAOYAS

|StdInChI_Ref = {{stdinchicite|changed|chemspider}}

|StdInChI = 1S/C19H31NO3/c1-15(2)9-7-5-4-6-8-10-19(22)20-14-16-11-12-17(21)18(13-16)23-3/h11-13,15,21H,4-10,14H2,1-3H3,(H,20,22)

|StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

|StdInChIKey = AKDLSISGGARWFP-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

|C=19 | H=31 | N=1 | O=3

}}

}}

{{Infobox pepper

| heat = Above peak

| scoville = 8,600,000{{cite journal | vauthors = Govindarajan, Sathyanarayana | date = 1991 | title = Capsicum — Production, Technology, Chemistry, and Quality. Part V. Impact on Physiology, Pharmacology, Nutrition, and Metabolism; Structure, Pungency, Pain, and Desensitization Sequences | journal = Critical Reviews in Food Science and Nutrition | volume = 29 | issue = 6 | pages = 435–474 | doi=10.1080/10408399109527536 | pmid = 2039598}}

}}

Homodihydrocapsaicin is a capsaicinoid and analog and congener of capsaicin in chili peppers (Capsicum). Like capsaicin it is an irritant. Homodihydrocapsaicin accounts for about 1% of the total capsaicinoids mixture{{cite journal | vauthors = Bennett DJ, Kirby GW | year = 1968 | title = Constitution and biosynthesis of capsaicin| journal = J. Chem. Soc. C | pages = 442 | doi = 10.1039/j39680000442 }} and has about half the pungency of capsaicin. Pure homodihydrocapsaicin is a lipophilic colorless odorless crystalline to waxy compound. It produces "numbing burn" in the throat and is one of the most prolonged and difficult to rinse out. On the Scoville scale it has 8,600,000 SHU (Scoville heat units).