Hopane

{{Chembox

| Name =

| Reference = {{cite web | url = http://www.chem.qmul.ac.uk/iupac/sectionF/terpenoid/terp25a.html | title = Hopane | archive-url = https://web.archive.org/web/20110609012855/http://www.chem.qmul.ac.uk/iupac/sectionF/terpenoid/terp25a.html | archive-date = 2011-06-09 | url-status = dead | access-date = 2021-03-30 | website = IUPAC Recommendations 1999, Revised Section F: Natural Products and Related Compounds | date = 1999 }}

| ImageFile = hopane.svg

| ImageSize =

| IUPACName = Hopane{{cite book |author=International Union of Pure and Applied Chemistry |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=The Royal Society of Chemistry |pages=1536 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}

| SystematicName = (3R,3aS,5aR,5bR,7aS,11aS,11bR,13aR,13bS)-5a,5b,8,8,11a,13b-Hexamethyl-3-(propan-2-yl)icosahydro-1H-cyclopenta[a]chrysene

| OtherNames = A'-Neogammacerane

| Section1 = {{Chembox Identifiers

| CASNo = 471-62-5

| CASNo_Ref = {{cascite|correct|}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W2H93796GT

| PubChem = 10115

| ChemSpiderID = 9711

| SMILES = [C@@H]54[C@]([C@@H]3[C@@]([C@]1([C@@H]([C@]2(C)[C@@H](CC1)C(C)(C)CCC2)CC3)C)(C)CC4)(C)CC[C@@H]5C(C)C

| InChI = 1/C30H52/c1-20(2)21-12-17-27(5)22(21)13-18-29(7)24(27)10-11-25-28(6)16-9-15-26(3,4)23(28)14-19-30(25,29)8/h20-25H,9-19H2,1-8H3/t21-,22+,23+,24-,25-,27+,28+,29-,30-/m1/s1

| InChIKey = ZRLNBWWGLOPJIC-PYQRSULMBH

| StdInChI = 1S/C30H52/c1-20(2)21-12-17-27(5)22(21)13-18-29(7)24(27)10-11-25-28(6)16-9-15-26(3,4)23(28)14-19-30(25,29)8/h20-25H,9-19H2,1-8H3/t21-,22+,23+,24-,25-,27+,28+,29-,30-/m1/s1

| StdInChIKey = ZRLNBWWGLOPJIC-PYQRSULMSA-N

}}

| Section2 = {{Chembox Properties

| C=30 | H=52

| Appearance =

| Density = 0.952 g/ml

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

| Section4 =

| Section5 =

| Section6 =

}}

Hopane is a natural chemical compound classified as a triterpene. It forms the central core of a variety of other chemical compounds which are collectively known as hopanoids. The first compound of the hopane family to be isolated and characterised was hydroxyhopanone, found in dammar resin.{{cite journal |author1=Mills J.S. |author2=Werner A.E.A. | title = The Chemistry of Dammar Resin | journal = Journal of the Chemical Society | pages = 3132–40 | year = 1955|doi=10.1039/jr9550003132 }} The name derives from Hopea, a tree genus from which dammar is obtained.{{cite journal | first1 = Mohamad | last1 = Pauzi Zakaria | first2 = Suhaimi | last2 = Suratman | first3 = Nor | last3 =Sayzwani Sukri | first4 = Vahab | last4 = Vaezzadeh | first5 = Chu | last5 = Wei Bong | title = APPLICATION OF PENTACYCLIC TRITERPANES AS A BIOMARKER IN IDENTIFYING THE SOURCE OF OIL POLLUTION IN THE EAST COAST OF PENINSULAR MALAYSIA | journal = Perintis | date = 2017 | volume = 7 | number = 2 | pages = 95–110}}