Hydrocortisone buteprate

{{Short description|Chemical compound}}

{{See also|hydrocortisone}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447611730

| image = Hydrocortisone buteprate.svg

| USAN = hydrocortisone probutate

| tradename = Pandel

| Drugs.com = {{drugs.com|monograph|hydrocortisone-topical}}

| pregnancy_AU = A

| pregnancy_AU_comment = {{cite web | title=Hydrocortisone topical Use During Pregnancy | website=Drugs.com | date=5 December 2019 | url=https://www.drugs.com/pregnancy/hydrocortisone-topical.html | access-date=13 September 2020}}

| pregnancy_US = C

| pregnancy_US_comment =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US = OTC

| legal_status =

| routes_of_administration = Topical

| ATC_prefix = D07

| ATC_suffix = AB11

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 72590-77-3

| PubChem = 636398

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB14543

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 552186

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = O6550D6K3A

| KEGG = D01886

| KEGG2 = C13358

| ChEBI = 31675

| ChEMBL = 200953

| synonyms = Hydrocortisone probutate; Hydrocortisone 17α-butyrate 21-propionate; Hydrocortisone butyrate propionate

| IUPAC_name = (11β)-11-hydroxy-3,20-dioxo-21-(propionyloxy)pregn-4-en-17-yl butyrate

| C=28 | H=40 | O=7

| SMILES = CCCC(=O)O[C@@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)O)C)C(=O)COC(=O)CC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C28H40O7/c1-5-7-24(33)35-28(22(31)16-34-23(32)6-2)13-11-20-19-9-8-17-14-18(29)10-12-26(17,3)25(19)21(30)15-27(20,28)4/h14,19-21,25,30H,5-13,15-16H2,1-4H3/t19-,20-,21-,25+,26-,27-,28-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = FOGXJPFPZOHSQS-AYVLZSQQSA-N

}}

Hydrocortisone buteprate, also known as hydrocortisone probutate and as hydrocortisone butyrate propionate, is a topical corticosteroid.Drugs.com: [https://www.drugs.com/monograph/hydrocortisone-buteprate-topical.html Hydrocortisone Buteprate topical]{{cite journal | vauthors = Sears HW, Bailer JW, Yeadon A | title = Efficacy and safety of hydrocortisone buteprate 0.1% cream in patients with atopic dermatitis | journal = Clinical Therapeutics | volume = 19 | issue = 4 | pages = 710–9 | year = 1997 | pmid = 9377615 | doi = 10.1016/s0149-2918(97)80095-1 }} It is an ester of hydrocortisone (cortisol) with butyric acid and propionic acid.