Hydroxetamine

{{Short description|Chemical compound}}

{{drugbox

| drug_name = Hydroxetamine

| image = Hydroxetamine.svg

| image_class = skin-invert-image

| legal_CA = HXE is not specifically scheduled but ketamine and its analogues are schedule I

| legal_UK = Class B

| legal_DE = NpSG

| C = 14 | H = 19 | N = 1 | O = 2

| IUPAC_name = 2-(ethylamino)-2-(3-hydroxyphenyl)cyclohexan-1-one

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 1620054-73-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = JQ2YE6NTZ8

| ChemSpiderID = 112747181

| PubChem = 163192347

| smiles = O=C1CCCCC1(NCC)C2=CC(O)=CC=C2

| StdInChI = 1S/C14H19NO2/c1-2-15-14(9-4-3-8-13(14)17)11-6-5-7-12(16)10-11/h5-7,10,15-16H,2-4,8-9H2,1H3

| StdInChIKey = CQERUJSORROCGH-UHFFFAOYSA-N

}}

Hydroxetamine (3'-hydroxy-2-oxo-PCE, O-desmethylmethoxetamine, HXE) is a recreational designer drug from the arylcyclohexylamine family, with dissociative effects. It is known as an active metabolite of the dissociative designer drug methoxetamine,{{cite journal | vauthors = Menzies EL, Hudson SC, Dargan PI, Parkin MC, Wood DM, Kicman AT | title = Characterizing metabolites and potential metabolic pathways for the novel psychoactive substance methoxetamine | journal = Drug Testing and Analysis | volume = 6 | issue = 6 | pages = 506–15 | date = June 2014 | pmid = 24574323 | doi = 10.1002/dta.1541 }}{{cite journal | vauthors = Horsley RR, Lhotkova E, Hajkova K, Jurasek B, Kuchar M, Palenicek T | title = Detailed pharmacological evaluation of methoxetamine (MXE), a novel psychoactive ketamine analogue-Behavioural, pharmacokinetic and metabolic studies in the Wistar rat | journal = Brain Research Bulletin | volume = 126 | issue = Pt 1 | pages = 102–110 | date = September 2016 | pmid = 27155360 | doi = 10.1016/j.brainresbull.2016.05.002 | s2cid = 3955788 }} but has also been sold in its own right since late 2019.[https://ndews.org/?wysija-page=1&controller=email&action=view&email_id=157&wysijap=subscriptions Alert from NDEWS Web Monitoring Team: Increases in Reddit discussions of HXE in February-May of 2021. National Drug Early Warning System, Issue 39, 11 June 2021. University of Florida, funded by the National Institute on Drug Abuse]