Hydroxyestrone diacetate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,13S,14S,16R)-3-acetyloxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate

| image = Hydroxyestrone diacetate.svg

| width = 250px

| tradename = Colpoginon, Colpormon, Hormobion, Hormocervix

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class = Estrogen; Estrogen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1247-71-8

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 102046

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 92184

| UNII = 2U3VOE52DG

| synonyms = RD-310; 16α-Hydroxyestrone diacetate; 3,16α-Dihydroxyestra-1,3,5(10)-trien-17-one 3,16α-diacetate

| C=22 | H=26 | O=5

| SMILES = CC(=O)OC1CC2C3CCC4=C(C3CCC2(C1=O)C)C=CC(=C4)OC(=O)C

| StdInChI_Ref =

| StdInChI = 1S/C22H26O5/c1-12(23)26-15-5-7-16-14(10-15)4-6-18-17(16)8-9-22(3)19(18)11-20(21(22)25)27-13(2)24/h5,7,10,17-20H,4,6,8-9,11H2,1-3H3/t17-,18-,19+,20-,22+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = QZQSENRWYLQIPC-JPVHLGFFSA-N

}}

Hydroxyestrone diacetate (brand names Colpoginon, Colpormon, Hormobion, Hormocervix) (former developmental code name RD-310), or 16α-hydroxyestrone diacetate, also known as 3,16α-dihydroxyestra-1,3,5(10)-trien-17-one 3,16α-diacetate, is a synthetic, steroidal estrogen which has been marketed in France, Spain, Brazil, and Argentina.{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA531|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=531–}}{{cite book| vauthors = Negwer M, Scharnow HG |title=Organic-chemical drugs and their synonyms: (an international survey)|url=https://books.google.com/books?id=zmpqAAAAMAAJ|year=2001|publisher=Wiley-VCH|isbn=978-3-527-30247-5}} It is a derivative of 16α-hydroxyestrone with an acetate esters attached at the C3 and C16α positions.