Hydroxystilbamidine
{{chembox
| Verifiedfields = changed
| verifiedrevid = 461773992
|ImageFile=Hydroxystilbamidine.svg
|ImageSize=
|PIN=4-[(E)-2-(4-Carbamimidoylphenyl)ethen-1-yl]-3-hydroxybenzene-1-carboximidamide
|OtherNames=
|Section1= {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10612853
| InChI = 1/C16H16N4O/c17-15(18)12-5-2-10(3-6-12)1-4-11-7-8-13(16(19)20)9-14(11)21/h1-9,21H,(H3,17,18)(H3,19,20)/b4-1+
| InChIKey = TUESWZZJYCLFNL-DAFODLJHBK
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H16N4O/c17-15(18)12-5-2-10(3-6-12)1-4-11-7-8-13(16(19)20)9-14(11)21/h1-9,21H,(H3,17,18)(H3,19,20)/b4-1+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TUESWZZJYCLFNL-DAFODLJHSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo=495-99-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 39J262E49W
| PubChem=5353676
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1301
| SMILES=Oc2cc(ccc2/C=C/c1ccc(cc1)C(N)=N)C(N)=N
}}
|Section2= {{Chembox Properties
| Formula=C16H16N4O
| MolarMass=280.324 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt=
}}
}}
File:PVH neurons of Long-Evans rat marked with retrograde tracer floro-gold.tif
Hydroxystilbamidine is a fluorescent dye that emits different frequencies of light when bound to DNA and RNA. It is used as a retrograde tracer{{cite journal|doi=10.1016/S0165-0270(00)00292-2|title=Retrograde tracing with Fluoro-Gold: different methods of tracer detection at the ultrastructural level and neurodegenerative changes of back-filled neurons in long-term studies|year=2000|last1=Naumann|first1=Thomas|journal=Journal of Neuroscience Methods|volume=103|issue=1|pages=11–21|pmid=11074092 |s2cid=24155326}} for outlining neurons, and as a histochemical stain.