Hypidone

{{Short description|Investigational antidepressant drug}}

{{cs1 config|name-list-style=vanc}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Hypidone_structure.png

| width = 250px

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 1339339-18-2

| CAS_supplemental =
1339058-04-6 (HCl)

| PubChem = 54673543

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 68055492

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = YL-0919; YL0919

| IUPAC_name = 1-[(1-benzyl-4-hydroxypiperidin-4-yl)methyl]pyridin-2-one

| C=18 | H=22 | N=2 | O=2

| SMILES = C1CN(CCC1(CN2C=CC=CC2=O)O)CC3=CC=CC=C3

| StdInChI = 1S/C18H22N2O2/c21-17-8-4-5-11-20(17)15-18(22)9-12-19(13-10-18)14-16-6-2-1-3-7-16/h1-8,11,22H,9-10,12-15H2

| StdInChI_comment =

| StdInChIKey = BGMVOROUOUVVRV-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Hypidone (developmental code name YL-0919) is an investigational serotonergic antidepressant which is under development for the treatment of major depressive disorder.{{Cite web|title=Hypidone hydrochloride - Shanghai Synergy Pharmaceutical Sciences - AdisInsight|url=https://adisinsight.springer.com/drugs/800051181|access-date=2021-10-09|website=adisinsight.springer.com}}{{cite journal | vauthors = Zhang LM, Wang XY, Zhao N, Wang YL, Hu XX, Ran YH, Liu YQ, Zhang YZ, Yang RF, Li YF | title = Neurochemical and behavioural effects of hypidone hydrochloride (YL-0919): a novel combined selective 5-HT reuptake inhibitor and partial 5-HT1A agonist | journal = British Journal of Pharmacology | volume = 174 | issue = 9 | pages = 769–780 | date = May 2017 | pmid = 27882537 | pmc = 5386994 | doi = 10.1111/bph.13675 | url = }}{{cite journal | vauthors = Chen XF, Jin ZL, Gong Y, Zhao N, Wang XY, Ran YH, Zhang YZ, Zhang LM, Li YF | title = 5-HT6 receptor agonist and memory-enhancing properties of hypidone hydrochloride (YL-0), a novel 5-HT1A receptor partial agonist and SSRI | journal = Neuropharmacology | volume = 138 | issue = | pages = 1–9 | date = August 2018 | pmid = 29805118 | doi = 10.1016/j.neuropharm.2018.05.027 | s2cid = 44125 | url = }}{{cite journal | vauthors = Yin YY, Tian CY, Fang XX, Shang C, Zhang LM, Xu Q, Li YF | title = The Faster-Onset Antidepressant Effects of Hypidone Hydrochloride (YL-0919) in Monkeys Subjected to Chronic Unpredictable Stress | journal = Front Pharmacol | volume = 11 | issue = | pages = 586879 | date = 2020 | pmid = 33324217 | pmc = 7725870 | doi = 10.3389/fphar.2020.586879 | url = | doi-access = free }}{{cite journal | vauthors = Liu WG, Zhang LM, Yao JQ, Yin YY, Zhang XY, Li YF, Cao JB | title = Anti-PTSD Effects of Hypidone Hydrochloride (YL-0919): A Novel Combined Selective 5-HT Reuptake Inhibitor/5-HT1A Receptor Partial Agonist/5-HT6 Receptor Full Agonist | journal = Front Pharmacol | volume = 12 | issue = | pages = 625547 | date = 2021 | pmid = 33643051 | pmc = 7902863 | doi = 10.3389/fphar.2021.625547 | url = | doi-access = free }} It acts as a serotonin reuptake inhibitor, 5-HT_1A receptor partial agonist, and 5-HT₆ receptor full agonist. It is used as the hydrochloride salt. As of January 2021, hypidone is in phase 2 clinical trials for major depressive disorder.