Ifoxetine

{{Short description|Chemical compound}}

{{Distinguish|Fluoxetine}}

{{Drugbox

| IUPAC_name = (3R,4S)-4-(2,3-dimethylphenoxy)piperidin-3-ol

| image = Ifoxetine Structure.svg

| image_class = skin-invert-image

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 66208-11-5

| ATC_prefix = none

| ATC_suffix =

| PubChem = 71971

| ChEMBL = 2218865

| ChemSpiderID = 64977

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LHH887104B

| C=13 | H=19 | N=1 | O=2

| smiles = O(c1cccc(c1C)C)[C@H]2CCNC[C@H]2O

}}

Ifoxetine (CGP-15,210-G) is a selective serotonin reuptake inhibitor (SSRI) which was investigated as an antidepressant in the 1980s but was never marketed.{{cite journal |vauthors=Burrows GD, McIntyre IM, Judd FK, Norman TR | title = Clinical effects of serotonin reuptake inhibitors in the treatment of depressive illness | journal = The Journal of Clinical Psychiatry | volume = 49 Suppl | pages = 18–22 |date=August 1988 | pmid = 3045107 }}{{cite journal |vauthors=Waldmeier PC, Maître L, Baumann PA, etal | title = Ifoxetine, a compound with atypical effects on serotonin uptake | journal = European Journal of Pharmacology | volume = 130 | issue = 1–2 | pages = 1–10 |date=October 1986 | pmid = 2877890 | doi = 10.1016/0014-2999(86)90177-9}}{{cite journal |vauthors=Delini-Stula A, Fischbach R, Gauthier JM, etal | title = First clinical experience with ifoxetine, a new 5-HT reuptake blocker with particular emphasis on the side-effect profile of the 5-HT-uptake inhibiting drugs | journal = International Clinical Psychopharmacology | volume = 2 | issue = 3 | pages = 201–15 |date=July 1987 | pmid = 3320185 | doi = 10.1097/00004850-198707000-00003}} Ifoxetine selectively blocks the reuptake of serotonin in the brain supposedly without affecting it in the periphery. Supporting this claim, ifoxetine was found to be efficacious in clinical trials and was very well tolerated, producing almost no physical side effects or other complaints of significant concern.

References