Ilaprazole
{{short description|Stomach acid suppressing medication}}
{{more citations needed|date=October 2012}}
{{Drugbox
| IUPAC_name = 2-[(RS)-[(4-methoxy-3-methylpyridin-2-yl)methyl]sulfinyl]-5-(1H-pyrrol-1-yl)-1H-benzimidazole
| image = Ilaprazole.svg
| width = 250
| alt =
| caption =
| tradename = Noltec
| pregnancy_AU =
| pregnancy_category =
| routes_of_administration = By mouth
| ATC_prefix = A02
| ATC_suffix = BC11
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 172152-36-2
| PubChem = 214351
| DrugBank =
| ChEMBL = 2106370
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 776Q6XX45J
| ChemSpiderID = 185839
| KEGG = D13013
| C=19 | H=18 | N=4 | O=2 | S=1
| smiles = Cc1c(OC)ccnc1CS(=O)c2[nH]c3ccc(cc3n2)n4cccc4
| StdInChI = 1S/C19H18N4O2S/c1-13-17(20-8-7-18(13)25-2)12-26(24)19-21-15-6-5-14(11-16(15)22-19)23-9-3-4-10-23/h3-11H,12H2,1-2H3,(H,21,22)
| StdInChIKey = HRRXCXABAPSOCP-UHFFFAOYSA-N
}}
Ilaprazole (trade name Noltec) is a proton pump inhibitor (PPI) used in the treatment of dyspepsia, peptic ulcer disease (PUD), gastroesophageal reflux disease (GORD/GERD){{cite journal | vauthors = Savarino E, Ottonello A, Martinucci I, Dulbecco P, Savarino V | title = Ilaprazole for the treatment of gastro-esophageal reflux | journal = Expert Opinion on Pharmacotherapy | volume = 17 | issue = 15 | pages = 2107–13 | date = October 2016 | pmid = 27598861 | doi = 10.1080/14656566.2016.1232389 | s2cid = 38638311 }} and duodenal ulcer.{{cite journal | vauthors = Bohidar NP, Krishna K, Panda BK, Patel C | title = Ilaprazole: Is this a superior proton pump inhibitor for duodenal ulcer? | journal = Tropical Gastroenterology | volume = 34 | issue = 2 | pages = 95–8 | date = 2013 | pmid = 24377157 | doi = 10.7869/tg.2012.105 | doi-access = free }}{{cite journal | vauthors = Ji XQ, Du JF, Chen G, Chen G, Yu B | title = Efficacy of ilaprazole in the treatment of duodenal ulcers: a meta-analysis | journal = World Journal of Gastroenterology | volume = 20 | issue = 17 | pages = 5119–23 | date = May 2014 | pmid = 24803828 | pmc = 4009550 | doi = 10.3748/wjg.v20.i17.5119 | doi-access = free }}
It is available in strengths of 5, 10, and 20 mg.
Clinical studies show that ilaprazole is at least as potent a PPI as omeprazole when taken in equivalent doses. Studies also showed that ilaprazole significantly prevented the development of reflux oesophagitis.
Ilaprazole is developed by Il-Yang Pharmaceutical (Korea), and is still under clinical trials with US FDA. It has launched in Korea and China for the treatment of gastric ulcer, duodenal ulcer, gastroesophageal reflux disease and erosive esophagitis.{{ClinicalTrialsGov|NCT00952978|Ilaprazole for the Treatment of Duodenal Ulcer in Chinese Patients (Phase 3)}}
Ilaprazole is sold in Mexico by Chinoin Pharmaceuticals under the brand name Norutec.{{cite web | title = Norutec | work = Chinoin Pharmaceuticals | url = https://www.actuamed.com.mx/marca/713471 }}