Ilepcimide
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 451225156
| IUPAC_name = (2E)-3-(2H-1,3-Benzodioxol-5-yl)-1-(piperidin-1-yl)prop-2-en-1-one
| image = Ilepcimide.png
| width = 200px
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 82857-82-7
| ATC_prefix = none
| ATC_suffix =
| PubChem = 641115
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5ML58O200F
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 556435
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H17NO3/c17-15(16-8-2-1-3-9-16)7-5-12-4-6-13-14(10-12)19-11-18-13/h4-7,10H,1-3,8-9,11H2/b7-5+
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = BLPUOQGPBJPXRL-FNORWQNLSA-N
| C=15 | H=17 | N=1 | O=3
| smiles = C1CCN(CC1)C(=O)/C=C/C2=CC3=C(C=C2)OCO3
}}
Ilepcimide, also known as antiepilepserine, is an anticonvulsant.{{cite book | vauthors = Ganellin CR, Triggle DJ | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1116 | accessdate = 30 November 2012 | date = 21 November 1996 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1116}} It is a piperidine derivative that was first synthesized by Chinese researchers as an analogue of piperine, the main pungent compound and phytochemical of black pepper (and of other plants in the family Piperaceae).
Ilepcimide has serotonergic activity.{{cite journal | vauthors = Liu GQ, Algeri S, Ceci A, Garattini S, Gobbi M, Murai S | title = Stimulation of serotonin synthesis in rat brain after antiepilepsirine, an antiepileptic piperine derivative | journal = Biochemical Pharmacology | volume = 33 | issue = 23 | pages = 3883–6 | date = December 1984 | pmid = 6210090 | doi = 10.1016/0006-2952(84)90055-8 | doi-access = free }}{{cite journal | vauthors = Yan QS, Mishra PK, Burger RL, Bettendorf AF, Jobe PC, Dailey JW | title = Evidence that carbamazepine and antiepilepsirine may produce a component of their anticonvulsant effects by activating serotonergic neurons in genetically epilepsy-prone rats | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 261 | issue = 2 | pages = 652–9 | date = May 1992 | pmid = 1374472 }}