Imiclopazine
{{Short description|Antipsychotic medication}}
{{Infobox drug
| Watchedfields =
| verifiedrevid =
| INN = Imiclopazine
| IUPAC_name = 1-[2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethyl]-3-methylimidazolidin-2-one
| drug_name =
| synonyms =
| type =
| image = Imiclopazine.png
| image_class = skin-invert-image
| width =
| alt =
| caption =
| image2 =
| width2 =
| pronounce =
| tradename = Ponsital{{Cite book | vauthors = Milne GW |url=https://books.google.com/books?id=QxcoEAAAQBAJ&pg=PA427 |title=Drugs: Synonyms and Properties |date=2002-02-01 |publisher=John Wiley & Sons |isbn=978-0-566-08491-1 |edition=2nd |pages=427 |language=en}}{{Cite news |date=1986-11-05 |title=Substâncias e remédios sob controle |language=pt-br |trans-title=Substances and drugs under control |pages=14 |work=Jornal do Brasil |url=https://memoria.bn.br/pdf/030015/per030015_1986_00211.pdf |url-status=live |access-date=2023-08-08 |archive-url=https://web.archive.org/web/20230808230340/https://memoria.bn.br/pdf/030015/per030015_1986_00211.pdf |archive-date=2023-08-08}}
| Drugs.com =
| MedlinePlus =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| routes_of_administration =
| ATC_prefix = N05
| ATC_suffix = AB
| legal_AU =
| legal_AU_comment =
| legal_BR = C1
| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-03 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| bioavailability =
| metabolism =
| protein_bound =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 7224-08-0
| PubChem = 23896
| IUPHAR_ligand =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22341
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = WGL8B3MDAS
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 135784
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 2105043
| C = 25| H = 32| Cl = 1| N = 5| O = 1| S = 1
| SMILES = CN1CCN(C1=O)CCN2CCN(CC2)CCCN3C4=CC=CC=C4SC5=C3C=C(C=C5)Cl
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C25H32ClN5OS/c1-27-11-17-30(25(27)32)18-16-29-14-12-28(13-15-29)9-4-10-31-21-5-2-3-6-23(21)33-24-8-7-20(26)19-22(24)31/h2-3,5-8,19H,4,9-18H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OCDYNPAUUKDNOR-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
Imiclopazine is an antipsychotic drug of the phenothiazines class, developed in the 1960s by the pharmaceutical company Asta-Werke under the brand name Ponsital. It demonstrated strong sedative and antiemetic properties.{{Cite web |title=Imiclopazine |url=https://drugs.ncats.io/drug/WGL8B3MDAS |access-date=2023-08-09 |work = NCATS Inxight Drugs | publisher = National Center for Advancing Translational Sciences (NCATS) |language=en}}{{cite journal | vauthors = Nurowska K, Welbel L | title = [Treatment of schizophrenia with imiclopazine, pimozide, imagotan and trifluorperidol. Comparative study] | journal = Psychiatria Polska | volume = 7 | issue = 1 | pages = 57–63 | date = 1973 | pmid = 4146043 }}
It was initially researched for the treatment of schizophrenia and had favorable clinical trials,{{Cite journal | vauthors = Eckmann F, Immich H, Schäpperle O |date=1968 |title=Langzeitbehandlung mit PONSITAL bei chronisch psychisch Kranken |url=https://www.karger.com/Article/FullText/467919 |journal=International Pharmacopsychiatry |language=de |volume=1 |issue=1 |pages=80–85 |doi=10.1159/000467919 |issn=0020-8272|url-access=subscription }} but ultimately was never brought to market.