Imiclopazine

{{Short description|Antipsychotic medication}}

{{Infobox drug

| Watchedfields =

| verifiedrevid =

| INN = Imiclopazine

| IUPAC_name = 1-[2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethyl]-3-methylimidazolidin-2-one

| drug_name =

| synonyms =

| type =

| image = Imiclopazine.png

| image_class = skin-invert-image

| width =

| alt =

| caption =

| image2 =

| width2 =

| pronounce =

| tradename = Ponsital{{Cite book | vauthors = Milne GW |url=https://books.google.com/books?id=QxcoEAAAQBAJ&pg=PA427 |title=Drugs: Synonyms and Properties |date=2002-02-01 |publisher=John Wiley & Sons |isbn=978-0-566-08491-1 |edition=2nd |pages=427 |language=en}}{{Cite news |date=1986-11-05 |title=Substâncias e remédios sob controle |language=pt-br |trans-title=Substances and drugs under control |pages=14 |work=Jornal do Brasil |url=https://memoria.bn.br/pdf/030015/per030015_1986_00211.pdf |url-status=live |access-date=2023-08-08 |archive-url=https://web.archive.org/web/20230808230340/https://memoria.bn.br/pdf/030015/per030015_1986_00211.pdf |archive-date=2023-08-08}}

| Drugs.com =

| MedlinePlus =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| routes_of_administration =

| ATC_prefix = N05

| ATC_suffix = AB

| legal_AU =

| legal_AU_comment =

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-03 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| metabolism =

| protein_bound =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 7224-08-0

| PubChem = 23896

| IUPHAR_ligand =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 22341

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WGL8B3MDAS

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 135784

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 2105043

| C = 25| H = 32| Cl = 1| N = 5| O = 1| S = 1

| SMILES = CN1CCN(C1=O)CCN2CCN(CC2)CCCN3C4=CC=CC=C4SC5=C3C=C(C=C5)Cl

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C25H32ClN5OS/c1-27-11-17-30(25(27)32)18-16-29-14-12-28(13-15-29)9-4-10-31-21-5-2-3-6-23(21)33-24-8-7-20(26)19-22(24)31/h2-3,5-8,19H,4,9-18H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OCDYNPAUUKDNOR-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Imiclopazine is an antipsychotic drug of the phenothiazines class, developed in the 1960s by the pharmaceutical company Asta-Werke under the brand name Ponsital. It demonstrated strong sedative and antiemetic properties.{{Cite web |title=Imiclopazine |url=https://drugs.ncats.io/drug/WGL8B3MDAS |access-date=2023-08-09 |work = NCATS Inxight Drugs | publisher = National Center for Advancing Translational Sciences (NCATS) |language=en}}{{cite journal | vauthors = Nurowska K, Welbel L | title = [Treatment of schizophrenia with imiclopazine, pimozide, imagotan and trifluorperidol. Comparative study] | journal = Psychiatria Polska | volume = 7 | issue = 1 | pages = 57–63 | date = 1973 | pmid = 4146043 }}

It was initially researched for the treatment of schizophrenia and had favorable clinical trials,{{Cite journal | vauthors = Eckmann F, Immich H, Schäpperle O |date=1968 |title=Langzeitbehandlung mit PONSITAL bei chronisch psychisch Kranken |url=https://www.karger.com/Article/FullText/467919 |journal=International Pharmacopsychiatry |language=de |volume=1 |issue=1 |pages=80–85 |doi=10.1159/000467919 |issn=0020-8272|url-access=subscription }} but ultimately was never brought to market.

References