Imidocarb

{{Chembox

| ImageFile = Imidocarb.svg

| PIN = N,N′-Bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea

| OtherNames = Imizocarb; Imizol; Diamidine

|Section1={{Chembox Identifiers

| CASNo = 27885-92-3

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 21389

| ChemSpiderID = 20102

| UNII = 8USS3K0VDH

| SMILES = O=C(Nc2cc(C/1=N/CCN\1)ccc2)Nc3cccc(c3)/C4=N/CCN4

| InChI = 1/C19H20N6O/c26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18/h1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26)

| InChIKey = SCEVFJUWLLRELN-UHFFFAOYAD

| StdInChI = 1S/C19H20N6O/c26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18/h1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26)

| StdInChIKey = SCEVFJUWLLRELN-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=19 | H=20 | N=6 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section6={{Chembox Pharmacology

| ATCvet = yes

| ATCCode_prefix = P51

| ATCCode_suffix = EX01

}}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Imidocarb is a urea derivative used in veterinary medicine as an antiprotozoal agent for the treatment of infection with Babesia (babesiosis) and other parasites.{{Cite journal | pmid = 608109 | year = 1977 | last1 = Hashemi-Fesharki | first1 = R | title = Studies on imidocarb dihydrochloride in experimental Babesia ovis infection in splenectomized lambs | volume = 133 | issue = 6 | pages = 609–14 | journal = The British Veterinary Journal| doi = 10.1016/S0007-1935(17)33941-6 }}{{Cite journal | pmid = 1212605 | year = 1975 | last1 = Hashemi-Fesharki | first1 = R | title = Studies on imidocarb dihydrochloride in experimental Babesia bigemina infection in calves | volume = 131 | issue = 6 | pages = 666–72 | journal = The British Veterinary Journal| doi = 10.1016/S0007-1935(17)35138-2 }}{{Cite journal | pmid = 7216881 | year = 1980 | last1 = Kuttler | first1 = KL | title = Pharmacotherapeutics of drugs used in treatment of anaplasmosis and babesiosis | volume = 176 | issue = 10 Spec No | pages = 1103–8 | journal = Journal of the American Veterinary Medical Association| doi = 10.2460/javma.1980.176.10.1103 }}

Mechanism of action

Imidocarb is anticholinergic; it inhibits acetylcholinesterase.{{cite web | url = https://go.drugbank.com/drugs/DB11521 | title = Imidocarb | access-date = November 23, 2024 | website = DrugBank}}{{cite book | title = Saunders Handbook of Veterinary Drugs | edition = 4th | date = 2016 | pages = 391–392 | isbn = 978-0-323-24485-5 | publisher = Elsevier | first = Mark G. | last = Papich | doi = 10.1016/B978-0-323-24485-5.00304-1}}

References