Imlunestrant

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Imlunestrant.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Investigational

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| synonyms = LY3484356

| CAS_number = 2408840-26-4

| PubChem = 146603228

| UNII = 9CXQ3PF69U

| DrugBank =

| ChEMBL = 5095183

| ChemSpiderID = 115010421

| KEGG = D12216

| StdInChI=1S/C29H24F4N2O3/c30-13-17-15-35(16-17)9-10-37-21-5-1-18(2-6-21)28-27-23-8-4-20(36)12-25(23)34-14-24(27)22-7-3-19(29(31,32)33)11-26(22)38-28/h1-8,11-12,14,17,28,36H,9-10,13,15-16H2/t28-/m1/s1

| StdInChIKey = UVBQMXOKKDCBJN-MUUNZHRXSA-N

| SMILES = C1C(CN1CCOC2=CC=C(C=C2)[C@@H]3C4=C5C=CC(=CC5=NC=C4C6=C(O3)C=C(C=C6)C(F)(F)F)O)CF

| IUPAC_name = (5R)-5-[4-[2-[3-(Fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-8-(trifluoromethyl)-5H-chromeno[4,3-c]quinolin-2-ol

| C = 29 | H = 24 | F = 4 | N = 2 | O = 3

}}

Imlunestrant is an experimental selective estrogen receptor degrader developed by Eli Lilly and Company for the treatment of some types of breast cancer.{{cite journal |last1=Neven |first1=P. |last2=Stahl |first2=N. |last3=Losada |first3=M.J. Vidal |last4=Jimenez |first4=M. Martin |last5=Kaufman |first5=P.A. |last6=Harbeck |first6=N. |last7=Hunt |first7=K. |last8=Carter |first8=S.A. |last9=Bidard |first9=F.C. |last10=Fasching |first10=P. |last11=Aftimos |first11=P.G. |last12=Wheatley |first12=D. |last13=Hamilton |first13=E.P. |last14=Aft |first14=R. |last15=Kulkarni |first15=S. |last16=Ismail-Khan |first16=R. |last17=Karacsonyi |first17=C. |last18=Estrem |first18=S.T. |last19=Ozbek |first19=U. |last20=Ciruelos |first20=E.M. |title=273P A preoperative window-of-opportunity (WOO) study of imlunestrant in ER+, HER2- early breast cancer (EBC): Final analysis from EMBER-2 |journal=Annals of Oncology |date=October 2023 |volume=34 |pages=S292–S293 |doi=10.1016/j.annonc.2023.09.470|s2cid=264385454 }}{{cite journal |last1=Jhaveri |first1=Komal |last2=O’Shaughnessy |first2=Joyce |last3=Andre |first3=Fabrice |last4=Goetz |first4=Matthew P. |last5=Harbeck |first5=Nadia |last6=Martín |first6=Miguel |last7=Bidard |first7=Francois-Clement |last8=Thomas |first8=Zachary M. |last9=Young |first9=Suzanne |last10=Ismail-Khan |first10=Roohi |last11=Smyth |first11=Lillian M. |last12=Gnant |first12=Michael |title=Abstract OT1-01-02: EMBER-4: A phase 3 adjuvant trial of imlunestrant vs standard endocrine therapy (ET) in patients with ER+, HER2- early breast cancer (EBC) with an increased risk of recurrence who have previously received 2 to 5 years of adjuvant ET |journal=Cancer Research |date=1 March 2023 |volume=83 |issue=5_Supplement |pages=OT1–01–02-OT1-01–02 |doi=10.1158/1538-7445.SABCS22-OT1-01-02}}{{cite journal |last1=Jhaveri |first1=Komal L. |last2=Jeselsohn |first2=Rinath |last3=Lim |first3=Elgene |last4=Hamilton |first4=Erika P. |last5=Yonemori |first5=Kan |last6=Beck |first6=J. Thaddeus |last7=Kaufman |first7=Peter A. |last8=Sammons |first8=Sarah |last9=Bhave |first9=Manali A. |last10=Saura |first10=Cristina |last11=Calvo |first11=Emiliano |last12=Meniawy |first12=Tarek |last13=Larson |first13=Timothy |last14=Ma |first14=Cynthia X. |last15=García-Corbacho |first15=Javier |last16=Cao |first16=Shanshan |last17=Estrem |first17=Shawn T. |last18=Milata |first18=Jennifer L. |last19=Nguyen |first19=Bastien |last20=Beeram |first20=Muralidhar |title=A phase 1a/b trial of imlunestrant (LY3484356), an oral selective estrogen receptor degrader (SERD) in ER-positive (ER+) advanced breast cancer (aBC) and endometrial endometrioid cancer (EEC): Monotherapy results from EMBER. |journal=Journal of Clinical Oncology |date=1 June 2022 |volume=40 |issue=16_suppl |pages=1021 |doi=10.1200/JCO.2022.40.16_suppl.1021|s2cid=249445691 }}