Impromidine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 378676793

| IUPAC_name = 2-[3-(1H-imidazol-5-yl)propyl]-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine

| image = Impromidine.svg

| width = 260

| image2 = Impromidine 3D.png

| tradename =

| routes_of_administration =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 55273-05-7

| ATC_prefix = none

| PubChem = 41376

| IUPHAR_ligand = 1226

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 931L4X5WMM

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 12608

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 37757

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H23N7S/c1-11-13(21-10-19-11)8-22-6-5-18-14(15)17-4-2-3-12-7-16-9-20-12/h7,9-10H,2-6,8H2,1H3,(H,16,20)(H,19,21)(H3,15,17,18)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MURRAGMMNAYLNA-UHFFFAOYSA-N

| C=14 | H=23 | N=7 | S=1

| smiles = Cc1[nH]cnc1CSCCNC(=N)NCCCc2c[nH]cn2

}}

Impromidine (INN) is a highly potent and specific histamine H₂ receptor agonist.{{cite journal |vauthors=Durant G, Duncan W, Ganellin C, Parsons M, Blakemore R, Rasmussen A |title=Impromidine (SK&F 92676) is a very potent and specific agonist for histamine H2 receptors |journal=Nature |volume=276 |issue=5686 |pages=403–5 |year=1978 |pmid=714166 |doi=10.1038/276403a0|s2cid=4242863 }}

It has been used diagnostically as a gastric secretion indicator.