Inaperisone
{{Short description|Muscle relaxant drug}}
{{Infobox drug
| drug_name =
| IUPAC_name = 1-(4-Ethylphenyl)-2-methyl-3-(1-pyrrolidinyl)-1-propanone
| image = Inaperisone skeletal.svg
| alt =
| caption =
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category=
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 99323-21-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0QAC3P785O
| ATCvet =
| ATC_prefix = None
| ATC_suffix =
| PubChem = 65860
| ChemSpiderID = 59271
| ChEMBL = 1797127
| DrugBank =
| C = 16 | H = 23 | N = 1 | O = 1
| smiles = CCC1=CC=C(C=C1)C(=O)C(C)CN2CCCC2
| StdInChI=1S/C16H23NO/c1-3-14-6-8-15(9-7-14)16(18)13(2)12-17-10-4-5-11-17/h6-9,13H,3-5,10-12H2,1-2H3
| StdInChIKey = VNFAARJCGSAROU-UHFFFAOYSA-N
}}
Inaperisone (INN) is a muscle relaxant.{{cite journal | vauthors = Nagata O, Murata M, Kato H, Terasaki T, Sato H, Tsuji A | title = Physiological pharmacokinetics of a new muscle-relaxant, inaperisone, combined with its pharmacological effect on blood flow rate | journal = Drug Metabolism and Disposition | volume = 18 | issue = 6 | pages = 902–10 | year = 1990 | pmid = 1981535 }}
See also
Chemically and mechanistically related drugs: