Inaperisone

{{Short description|Muscle relaxant drug}}

{{Infobox drug

| drug_name =

| IUPAC_name = 1-(4-Ethylphenyl)-2-methyl-3-(1-pyrrolidinyl)-1-propanone

| image = Inaperisone skeletal.svg

| alt =

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 99323-21-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0QAC3P785O

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 65860

| ChemSpiderID = 59271

| ChEMBL = 1797127

| DrugBank =

| C = 16 | H = 23 | N = 1 | O = 1

| smiles = CCC1=CC=C(C=C1)C(=O)C(C)CN2CCCC2

| StdInChI=1S/C16H23NO/c1-3-14-6-8-15(9-7-14)16(18)13(2)12-17-10-4-5-11-17/h6-9,13H,3-5,10-12H2,1-2H3

| StdInChIKey = VNFAARJCGSAROU-UHFFFAOYSA-N

}}

Inaperisone (INN) is a muscle relaxant.{{cite journal | vauthors = Nagata O, Murata M, Kato H, Terasaki T, Sato H, Tsuji A | title = Physiological pharmacokinetics of a new muscle-relaxant, inaperisone, combined with its pharmacological effect on blood flow rate | journal = Drug Metabolism and Disposition | volume = 18 | issue = 6 | pages = 902–10 | year = 1990 | pmid = 1981535 }}

See also

Chemically and mechanistically related drugs:

References

{{reflist}}

{{Muscle relaxants}}

Category:Muscle relaxants

Category:1-Pyrrolidinyl compounds

{{musculoskeletal-drug-stub}}