Indigo carmine

{{Short description|Blue dye derived from indigo}}

{{About|the blue dye derived from indigo|the unrelated red dye|Carmine||Carmine (disambiguation)}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477001402

| ImageFile = Indigo carmine.svg

| ImageSize = 300px

| ImageFile1 =Indigo-carmine-3D-balls.png

| ImageSize1 =300px

| PIN = Disodium [2(2′)E]-3,3′-dioxo-1,1′,3,3′-tetrahydro[2,2′-biindolylidene]-5,5′-disulfonate

| OtherNames = {{Unbulleted list|indigotine|5,5′-indigodisulfonic acid sodium salt|Brilliant Indigo|4 G|C.I. Acid Blue 74|C.I. 73015|CI Food Blue 1|FD&C Blue 2|Sicovit Indigotin 85|E132|indigotindisulfonate sodium}}

|Section1={{Chembox Identifiers

| Identifiers_ref =

| index_label =

| index1_label =

| indexlist_caption =

| index_comment =

| index1_comment =

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 860-22-0

| CASNo_Comment =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 31695

| ChEBI_Comment =

| ChEMBL = 2105023

| ChEMBL_Comment =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4447431

| ChemSpiderID_Comment =

| DrugBank = DB11577

| DrugBank_Comment =

| DrugBank1 = DBSALT001752

| DrugBank1_Comment =

| EC_number = 212-728-8

| IUPHAR_ligand =

| IUPHAR_ligand_Comment =

| KEGG = D01563

| KEGG_Comment =

| PubChem = 2723854

| PubChem_Comment =

| SMILES = [Na+].[Na+].[O-]S(=O)(=O)c3cc4C(=O)\C(=C2\C(=O)c1cc(ccc1N2)S([O-])(=O)=O)Nc4cc3

| SMILES_Comment =

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H10N2O8S2.2Na/c19-15-9-5-7(27(21,22)23)1-3-11(9)17-13(15)14-16(20)10-6-8(28(24,25)26)2-4-12(10)18-14;;/h1-6,17-18H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/b14-13+;;

| StdInChI_Comment =

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KHLVKKOJDHCJMG-QDBORUFSSA-L

| InChI = 1/C16H10N2O8S2.2Na/c19-15-9-5-7(27(21,22)23)1-3-11(9)17-13(15)14-16(20)10-6-8(28(24,25)26)2-4-12(10)18-14;;/h1-6,17-18H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/b14-13+;;

| InChI_Comment =

| InChIKey = KHLVKKOJDHCJMG-AKPRSONXBD

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D3741U8K7L

| UNII_Comment =

| Abbreviations =

| Beilstein =

| Gmelin =

| MeSHName =

| UNNumber =

}}

|Section2={{Chembox Properties

| Formula = C₁₆H₈N₂Na₂O₈S₂

| MolarMass = 466.36 g/mol

| Appearance = purple solid

| Density =

| MeltingPt = >{{convert|300|C}}

| BoilingPt =

| Solubility = 10 g/L ({{convert|25|C}})

}}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS exclamation mark}}{{cite web|title=Indigo carmine|url=http://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=TH&language=en&productNumber=131164&brand=SIAL&PageToGoToURL=http%3A%2F%2Fwww.sigmaaldrich.com%2Fcatalog%2Fproduct%2Fsial%2F131164%3Flang%3Den|website=Sigma Aldrich|access-date=15 Feb 2022}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302}}

| PPhrases =

| MainHazards =

| FlashPt =

| AutoignitionPt =

| NFPA-H = 2

| NFPA-F = 1

| NFPA-R = 0

| NFPA-S =

}}

| Section6 = {{Chembox Pharmacology

| Pharmacology_ref =

| ATCCode_prefix = V04

| ATCCode_suffix = CH02

| ATC_Supplemental =

| ATCvet =

| Licence_EU =

| INN =

| INN_EMA =

| Licence_US =

| Legal_status =

| Legal_AU =

| Legal_AU_comment =

| Legal_CA =

| Legal_CA_comment =

| Legal_NZ =

| Legal_NZ_comment =

| Legal_UK =

| Legal_UK_comment =

| Legal_US = Rx-only

| Legal_US_comment = {{cite web | title=Bludigo- indigotindisulfonate sodium injection | website=DailyMed | date=7 November 2022 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=73f246c4-b127-452e-856f-134b56cb8870 | access-date=21 January 2023}}

| Legal_EU =

| Legal_EU_comment =

| Legal_UN =

| Legal_UN_comment =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_AU_comment =

| Dependence_liability =

| AdminRoutes =

| Bioavail =

| ProteinBound =

| Metabolism =

| Metabolites =

| OnsetOfAction =

| HalfLife =

| DurationOfAction =

| Excretion =

}}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

{{Infobox drug

| drug_name = Indigotindisulfonate sodium

| INN =

| type =

| image =

| width =

| alt =

| caption =

| pronounce =

| tradename = Bludigo

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID = Indigotindisulfonate

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration =

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number =

| CAS_supplemental =

| PubChem =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID =

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name =

| chemical_formula_ref =

| chemical_formula =

| C= | H= | Ag= | Al= | As= | Au= | B= | Bi= | Br= | Ca= | Cl= | Co= | F= | Fe= | Gd= | I=

| K= | Li= | Mg= | Mn= | N= | Na= | O= | P= | Pt= | S= | Sb= | Se= | Sr= | Tc= | Zn= | charge=

| molecular_weight =

| molecular_weight_comment =

| SMILES =

| StdInChI =

| StdInChI_comment =

| StdInChIKey =

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Indigo carmine, or 5,5′-indigodisulfonic acid sodium salt, is an organic salt derived from indigo by aromatic sulfonation, which renders the compound soluble in water. Like indigo, it produces a blue color, and is used in food and other consumables, cosmetics, and as a medical contrast agent and staining agent; it also acts as a pH indicator. It is approved for human consumption in the United States and European Union.[https://www.fda.gov/ForIndustry/ColorAdditives/ColorAdditiveInventories/ucm115641.htm Summary of Color Additives for Use in United States in Foods, Drugs, Cosmetics, and Medical Devices], Food and Drug Administration[http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist Current EU approved additives and their E Numbers], Food Standards Agency, 26 November 2010 It has the E number E132, and is named Blue No. 2 by the US Federal Food, Drug, and Cosmetic Act.