Indole-3-acetaldehyde

{{Chembox

| ImageFile = Indole-3-acetaldehyde.svg

| ImageSize =

| ImageAlt =

| PIN = (1H-Indol-3-yl)acetaldehyde

| OtherNames = Indoleacetaldehyde; 1H-Indole-3-acetaldehyde; 2-(Indol-3-yl)acetaldehyde; Indole-3-acetaldehyde; Indoleacetaldehyde; 1H-Indol-3-ylacetaldehyde; 2-(3-Indolyl)acetaldehyde; Indol-3-ylacetaldehyde; Tryptaldehyde; IAL; IAAL

| Section1 = {{Chembox Identifiers

| CASNo = 2591-98-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = A346H8E8WU

| PubChem = 800

| ChemSpiderID = 778

| MeSHName = C001655

| ChEBI = 18086

| KEGG = C00637

| SMILES = O=CCC1=CNC2=CC=CC=C12

| StdInChI = InChI=1S/C10H9NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,6-7,11H,5H2

| StdInChIKey = WHOOUMGHGSPMGR-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=10 |H=9 |N=1 |O=1

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Indole-3-acetaldehyde (IAL) belongs to the class of organic compounds known as indoles. These are compounds containing an indole moiety, which consists of pyrrole ring fused to benzene to form 2,3-benzopyrrole. It is a metabolite of tryptamine formed by monoamine oxidase (MAO).

Indole-3-acetaldehyde is a substrate for retina-specific copper amine oxidase, aldehyde dehydrogenase X (mitochondrial), amine oxidase B, amiloride-sensitive amine oxidase, aldehyde dehydrogenase (mitochondrial), fatty aldehyde dehydrogenase, 4-trimethylaminobutyraldehyde dehydrogenase, aldehyde dehydrogenase (dimeric NADP-preferring), aldehyde dehydrogenase family 7 member A1, amine oxidase A, aldehyde dehydrogenase 1A3 and membrane copper amine oxidase.{{cite journal |journal = Arch Microbiol |date = 2016 |volume = 198 |issue =5 |pages = 429–37 |doi = 10.1007/s00203-016-1202-z |title = Indole-3-acetic acid biosynthetic pathways in the basidiomycetous yeast Rhodosporidium paludigenum |vauthors = Nutaratat P, Srisuk N, Arunrattiyakorn P, Limtong S |bibcode = 2016ArMic.198..429N |url = https://rd.springer.com/article/10.1007/s00203-016-1202-z|url-access = subscription }}