Indophenol

{{chembox

| verifiedrevid = 400118162

| ImageFile=Indophenol.svg

| ImageFile1 = Indophenol-3D-spacefill.png

| ImageAlt1 = Indophenol molecule

| ImageFile2 = Indophenol.jpg

| ImageSize=220

| IUPACName=4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one

| OtherNames=Benzenoneindophenol, phenolindophenol

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 9951

| InChI = 1/C12H9NO2/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10/h1-8,14H

| InChIKey = RSAZYXZUJROYKR-UHFFFAOYAS

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H9NO2/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10/h1-8,14H

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RSAZYXZUJROYKR-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=500-85-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BW444H326B

| PubChem=10379

| SMILES = O=C/2/C=C\C(=N\c1ccc(O)cc1)\C=C\2

}}

|Section2={{Chembox Properties

| C=12 | H=9 | N=1 | O=2

| Appearance=Reddish-blue powder

| Density=

| MeltingPt= above 300 °C

| MeltingPt_ref ={{cite book|author=Sabnis, R. W. |title=Handbook of Acid-Base Indicators|url=https://books.google.com/books?id=EzDbTL9Oah0C&pg=PA196|date=2007|publisher=CRC Press|isbn=978-0-8493-8219-2|page=196}}

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Indophenol is an organic compound with the formula OC₆H₄NC₆H₄OH. It is deep blue dye that is the product of the Berthelot's reaction, a common test for ammonia.{{cite journal|doi=10.1021/ac50011a034|title=Spectrophotometric and kinetics investigation of the Berthelot reaction for the determination of ammonia|journal=Analytical Chemistry|volume=49|issue=3|pages=464–469|year=1977|last1=Patton|first1=Charles J.|last2=Crouch|first2=S. R.}} The indophenol group, with various substituents in place of OH and various ring substitutions, is found in many dyes used in hair coloring and textiles.{{cite encyclopedia|author=Horst Berneth|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|year=2002|publisher=Wiley-VCH|place=Weinheim|doi=10.1002/14356007.a03_213.pub2|isbn=978-3527306732|chapter=Azine Dyes}}

Indophenol is used in hair dyes, lubricants, redox materials, liquid crystal displays, fuel cells and chemical-mechanical polishing. It is an environmental pollutant and is toxic to fish.{{Cite web|title=Indophenol I5763|url=https://www.sigmaaldrich.com/catalog/product/sigma/i5763|access-date=2020-06-11|website=500-85-6}}