Inositol pentakisphosphate

{{Chembox

| verifiedrevid = 443919745

| Name=myo-Inositol 1,3,4,5,6-pentakisphosphate

| ImageFile=myo-Inositol 1,3,4,5,6-pentakisphosphate.png

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames =

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 19951265

| InChI = 1/C6H17O21P5/c7-1-2(23-28(8,9)10)4(25-30(14,15)16)6(27-32(20,21)22)5(26-31(17,18)19)3(1)24-29(11,12)13/h1-7H,(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)/p-10/t1-,2+,3-,4-,5+,6+

| InChIKey = CTPQAXVNYGZUAJ-JSZKNSOJBF

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C6H17O21P5/c7-1-2(23-28(8,9)10)4(25-30(14,15)16)6(27-32(20,21)22)5(26-31(17,18)19)3(1)24-29(11,12)13/h1-7H,(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)/p-10/t1-,2+,3-,4-,5+,6+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CTPQAXVNYGZUAJ-KXXVROSKSA-D

| CASNo = 20298-95-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8444PN9XUW

| CASNo_Comment = [http://www.sigmaaldrich.com/catalog/product/sigma/i9261?lang=en®ion=US Sigma Aldrich]

| PubChem = 482

| KEGG = C15991

| Beilstein = 7685231

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 57733

| SMILES = O=P([O-])([O-])O[C@@H]1[C@@H](OP([O-])([O-])=O)[C@H](OP([O-])([O-])=O)[C@H](O)[C@H](OP([O-])([O-])=O)[C@H]1OP([O-])([O-])=O

}}

| Section2 = {{Chembox Properties

| C=6|H=17|O=21|P=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Inositol pentakisphosphate (abbreviated IP5) is a molecule derived from inositol tetrakisphosphate by adding a phosphate group with the help of Inositol-polyphosphate multikinase (IPMK). It is believed to be one of the many second messengers in the inositol phosphate family. It "is implicated in a wide array of biological and pathophysiological responses, including tumorigenesis, invasion and metastasis, therefore specific inhibitors of the kinase may prove useful in cancer therapy."{{cite journal | pmid=14755253 | year=2004 | last1=Piccolo | first1=E. | last2=Vignati | first2=S. | last3=Maffucci | first3=T. | last4=Innominato | first4=P. F. | last5=Riley | first5=A. M. | last6=Potter | first6=B. V. | last7=Pandolfi | first7=P. P. | last8=Broggini | first8=M. | last9=Iacobelli | first9=S. | last10=Innocenti | first10=Paolo | last11=Falasca | first11=Marco | title=Inositol pentakisphosphate promotes apoptosis through the PI 3-K/Akt pathway | volume=23 | issue=9 | pages=1754–1765 | doi=10.1038/sj.onc.1207296 | journal=Oncogene| display-authors=8 | doi-access= }}

IP5 also plays a role in defense signaling in plants. It potentiates the interaction of the plant hormone JA-Ile by its receptor.{{cite journal |last1=Sheard |first1=L. B. |year=2010 |title=Jasmonate perception by inositol phosphate-potentiated COI1-JAZ co-receptor|journal=Nature |volume=468 |pages=400–405 |doi=10.1038/nature09430 |pmid=20927106 |pmc=2988090 |issue=7322 |last2=Tan |first2=Xu |last3=Mao |first3=Haibin |last4=Withers |first4=John |last5=Ben-Nissan |first5=Gili |last6=Hinds |first6=Thomas R. |last7=Kobayashi |first7=Yuichi |last8=Hsu |first8=Fong-Fu |last9=Sharon |first9=Michal|last10=Browse |first10=John |last11=He |first11=Sheng Yang |last12=Rizo |first12=Josep |last13=Howe |first13=Gregg A. |last14=Zheng |first14=Ning |bibcode=2010Natur.468..400S |display-authors=8 }}{{cite journal |last1=Mosblech |first1=A. |year=2010 |title=Jasmonic acid perception by COI1 involves inositol polyphosphates in Arabidopsis thaliana |journal=The Plant Journal | volume=65 |issue=6 |pages=949–957 |doi=10.1111/j.1365-313X.2011.04480.x |pmid=21205029 |last2=Thurow |first2=Corinna |last3=Gatz |first3=Christiane |last4=Feussner |first4=Ivo |last5=Heilmann |first5=Ingo|doi-access=free }}

References

{{Reflist}}

{{DEFAULTSORT:Inositol Pentakisphosphate}}

Category:Organophosphates

Category:Inositol

Category:Phosphate esters

{{Biochem-stub}}