Iproclozide

{{short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 437134954

| IUPAC_name = 2-(4-chlorophenoxy)-N-isopropyl-acetohydrazide

| image = Iproclozide.svg

| image_class = skin-invert-image

| tradename =

| pregnancy_category =

| legal_AU =

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_EU =

| legal_UN =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3544-35-2

| ATC_prefix = N06

| ATC_suffix = AF06

| PubChem = 19063

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 17998

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1II9D6CB3J

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07338

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 91238

| C=11 | H=15 | Cl=1 | N=2 | O=2

| smiles = Clc1ccc(OCC(=O)NNC(C)C)cc1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C11H15ClN2O2/c1-8(2)13-14-11(15)7-16-10-5-3-9(12)4-6-10/h3-6,8,13H,7H2,1-2H3,(H,14,15)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GGECDTUJZOXAAR-UHFFFAOYSA-N

}}

Iproclozide (trade names Sursum, Sinderesin) is an irreversible and selective monoamine oxidase inhibitor (MAOI) of the hydrazine chemical class that was used as an antidepressant, but has since been discontinued.{{cite journal | vauthors = Suerinck A, Suerinck E | title = [Depressive states in a sanatorium milieu and monoamine oxidase inhibitors. (Therapeutic results by the combination of iproclozide and chlordiazepoxide). Apropos of 146 cases] | journal = Journal de Médecine de Lyon | volume = 47 | issue = 96 | pages = 573–586 | date = April 1966 | pmid = 5930723 }} It has been known to cause fulminant hepatitis and there have been at least three reported fatalities due to administration of the drug.{{cite journal | vauthors = Pessayre D, de Saint-Louvent P, Degott C, Bernuau J, Rueff B, Benhamou JP | title = Iproclozide fulminant hepatitis. Possible role of enzyme induction | journal = Gastroenterology | volume = 75 | issue = 3 | pages = 492–496 | date = September 1978 | pmid = 680506 | doi = 10.1016/0016-5085(78)90856-9 }}{{cite book | vauthors = Kaplowitz N, DeLeve LD | title = Drug-induced liver disease | publisher = Informa Health Care | year = 2003 | page = 455 | isbn = 0-8247-0811-3 }}