Iron(II) fumarate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 400119743

| ImageFile = Iron(II)fumarate.svg

| IUPACName = Iron(2+) (2E)-but-2-enedioate

| OtherNames = Ferrous fumarate; Feostat

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10607713

| InChI = 1/C4H4O4.Fe/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2/b2-1+;

| InChIKey = PMVSDNDAUGGCCE-FMKVMNOJBF

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C4H4O4.Fe/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2/b2-1+;

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PMVSDNDAUGGCCE-TYYBGVCCSA-L

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=141-01-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = R5L488RY0Q

| PubChem=6433164

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200640

| SMILES = [Fe+2].[O-]C(=O)/C=C/C([O-])=O

}}

|Section2={{Chembox Properties

| C = 4 | H = 2 | Fe = 1 | O = 4

| Appearance= reddish-brown powder

| Odor = odorless

| Density= 2.435 g/cm³ (20 °C)

| MeltingPtC= 280

| BoilingPt=

| Solubility= slightly soluble

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = B03

| ATCCode_suffix = AA02

}}

|Section7={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

| NFPA-H = 1

| NFPA-F = 0

| NFPA-R = 0

| LD50 = 3850 mg/kg (oral, rat)

}}

}}

Iron(II) fumarate, also known as ferrous fumarate, is the iron(II) salt of fumaric acid, occurring as a reddish-orange powder, used to supplement iron intake. It has the chemical formula {{chem2|auto=1|C4H2FeO4}}. Pure ferrous fumarate has an iron content of 32.87%, therefore one tablet of 300 mg iron fumarate will contain 98.6 mg of iron (548% Daily Value based on 18 mg RDI).