Iron(II) oxalate

{{chembox

|Verifiedfields = changed

|Watchedfields = changed

|verifiedrevid = 409714131

|ImageFile1 = Iron(II)-oxalate-sample.jpg

|ImageFile2 = Fe(C2O4)-2D-ionic.png

|IUPACName = Iron(II) oxalate

|OtherNames = Iron oxalate
Ferrous oxalate

|Section1={{Chembox Identifiers

|CASNo1_Ref = {{cascite|correct|CAS}}

|CASNo1 = 516-03-0

|CASNo2_Ref = {{cascite|correct|CAS}}

|CASNo2 = 6047-25-2

|index1_label = (anhydrous)

|index2_label = (dihydrate)

| ChemSpiderID1 = 10144

| ChemSpiderID2 = 450862

| DTXSID2 = DTXSID90975879

|UNII1_Ref = {{fdacite|correct|FDA}}

|UNII1 = DZP4YV3ICV

|UNII2_Ref = {{fdacite|correct|FDA}}

|UNII2 = Z6X3YBU50D

|PubChem1 =10589

| PubChem2 = 516788

|EC_number1 = 208-217-4

| EC_number2 = 611-981-5

|SMILES1 = [Fe+2].O=C([O-])-C([O-])=O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/3C2H2O4.2Fe/c3*3-1(4)2(5)6;;/h3*(H,3,4)(H,5,6);;/q;;;2*+3/p-6

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VEPSWGHMGZQCIN-UHFFFAOYSA-H

| InChI2=1S/C2H2O4.Fe.2H2O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;2*1H2/q;+2;;/p-2

| InChIKey2 = NPLZZSLZTJVZSX-UHFFFAOYSA-L

| SMILES2 = C(=O)(C(=O)[O-])[O-].O.O.[Fe+2]

}}

|Section2={{Chembox Properties

|Formula = FeC2O4 (anhydrous)
FeC2O4{{hydrate|2}} (dihydrate)

|MolarMass = 143.86 g/mol (anhydrous)
179.89 g/mol (dihydrate)

|Appearance = yellow powder

|Odor = odorless

|Density = 2.28 g/cm3

|MeltingPt =

|MeltingPt_notes = dihydrate: {{convert|150-160|C|F K}}
(decomposes)

|BoilingPtC =

|BoilingPt_notes =

|Solubility = dihydrate:
0.097 g/100ml (25 °C){{Cite web|url=http://chemister.ru/Database/properties-en.php?dbid=1&id=2084|title = Iron(II) oxalate dihydrate}}

}}

|Section3={{Chembox Hazards

|GHSPictograms = {{GHS07}}{{Sigma-Aldrich|id=255971|name=Iron(II) oxalate dihydrate|accessdate=2014-05-03}}

|GHSSignalWord = Warning

|HPhrases = {{H-phrases|302|312}}

|PPhrases = {{P-phrases|280}}

}}

}}

Ferrous oxalate (iron(II) oxalate) refers to inorganic compounds with the formula {{chem2|FeC2O4(H2O)_{x}|}} where x is 0 or 2. These are yellow compounds. Characteristic of metal oxalate complexes, these compounds tend to be polymeric, hence their low solubility in water.

Structure

Like other iron oxalates, ferrous oxalates feature octahedral Fe centers. The dihydrate {{chem2|FeC2O4(H2O)2}} is a coordination polymer, consisting of chains of oxalate-bridged ferrous centers, each with two aquo ligands.{{ cite journal |first1= Takuya |last1= Echigo |first2= Mitsuyoshi |last2= Kimata |title= Single-crystal X-ray diffraction and spectroscopic studies on humboldtine and lindbergite: weak Jahn–Teller effect of Fe2+ ion |journal= Physics and Chemistry of Minerals |year= 2008 |volume= 35 |issue= 8 |pages= 467–475 |doi= 10.1007/s00269-008-0241-7 |bibcode= 2008PCM....35..467E |s2cid= 98739882}}

File:Fe(C2O4)(H2O)2-chain-from-xtal-2008-CM-3D-balls.png

Reactions

When heated to 120 °C, the dihydrate dehydrates, and the anhydrous ferrous oxalate decomposes near 190 °C.{{cite journal |doi=10.1016/0040-6031(81)80175-x |title=Thermal decomposition of carbonates, carboxylates, oxalates, acetates, formates, and hydroxides |date=1981 |last1=Mu |first1=Jacob |last2=Perlmutter |first2=D.D. |journal=Thermochimica Acta |volume=49 |issue=2–3 |pages=207–218 |bibcode=1981TcAc...49..207M }} The product of thermal decomposition is a mixture of iron oxides and pyrophoric iron metal, as well as released carbon dioxide, carbon monoxide, and water.{{cite journal |title= Thermal Behaviour of Iron(II) Oxalate Dihydrate in the Atmosphere of Its Conversion Gases |first1= Martin |last1=Hermanek |first2=Radek |last2=Zboril |first3=Miroslav |last3=Mashlan |first4=Libor |last4=Machala |first5=Oldrich |last5=Schneeweiss |journal= J. Mater. Chem. |date= 2006 |volume= 16 |issue= 13 |pages= 1273–1280|doi= 10.1039/b514565a}}

Ferrous oxalates are precursors to iron phosphates, which are of value in batteries.{{cite journal |doi=10.1038/nmat2007 |title=A multifunctional 3.5 V iron-based phosphate cathode for rechargeable batteries |date=2007 |last1=Ellis |first1=B. L. |last2=Makahnouk |first2=W. R. M. |last3=Makimura |first3=Y. |last4=Toghill |first4=K. |last5=Nazar |first5=L. F. |journal=Nature Materials |volume=6 |issue=10 |pages=749–753 |pmid=17828278 |bibcode=2007NatMa...6..749E }}

Natural occurrence

Anhydrous iron(II) oxalate is unknown among minerals as of 2020. However, the dihydrate is known as humboldtine.{{Cite web|url=https://www.mindat.org/min-1946.html|title=Humboldtine}}{{Cite web|url=https://www.ima-mineralogy.org/Minlist.htm|title=List of Minerals|date=21 March 2011}} A related mineral is stepanovite ({{chem2|Na[Mg(H2O)6][Fe(C2O4)3]*3H2O}}), an unusual example of a naturally-occurring ferrioxalate.{{Cite web|url=https://www.mindat.org/min-3763.html|title=Stepanovite}}{{Cite web|url=https://www.ima-mineralogy.org/Minlist.htm|title=List of Minerals|date=21 March 2011}}

See also

References