Iron tris(dimethyldithiocarbamate)
{{Chembox
| ImageFile1 = ferbam.svg
| ImageSize1 = 200px
| ImageFile2 = DMTCFE01Fe(dtc)3tight.png
| ImageSize2 = 200px
| ImageAlt =
| IUPACName = Tris(dimethyldithiocarbamato)iron
| OtherNames = Ferric dimethyl dithiocarbamate, Ferbam
| Section1 = {{Chembox Identifiers
| CASNo = 14484-64-1
| PubChem = 26710
| EC_number = 238-484-2
| UNNumber = 3077, 2771
| UNII = SKM8W5154H
| KEGG = C11223
| ChEBI = 5015
| ChemSpiderID = 24884
| StdInChI=1S/3C3H7NS2.Fe/c3*1-4(2)3(5)6;/h3*1-2H3,(H,5,6);/q;;;+3/p-3
| StdInChIKey = WHDGWKAJBYRJJL-UHFFFAOYSA-K
| SMILES = CN(C)C(S1)S[Fe]123(SC(S2)N(C)C)SC(S3)N(C)C
| SMILES_Comment = coordination form
| SMILES1 = CN(C)C(=S)[S-].[Fe+3].CN(C)C(=S)[S-].CN(C)C(=S)[S-]
| SMILES1_Comment = ionic form
| RTECS = NO8750000
}}
| Section2 = {{Chembox Properties
| Formula = [(CH3)2NCS2]3Fe
| MolarMass = 416.5 g/mol
| Appearance = Dark brown to black, odorless solid
| Density = 1.52 g/cm3
| MeltingPt_notes = Decomposes above {{convert|180|C}}
| BoilingPt_notes = Decomposes
}}
| Section3 = {{Chembox Hazards
| MainHazards = Reacts with strong oxidizers, moisture
| FlashPt =
| AutoignitionPt =
| IDLH = 800 mg/m3{{PGCH|0286}}
| LD50 = 3000 mg/kg (rabbit, oral)
2000 mg/kg (guinea pig, oral)
1130 mg/kg (rat, oral)
3400 mg/kg (mouse, oral){{IDLH|14484641|Ferbam}}
}}
}}
Iron tris(dimethyldithiocarbamate) is the coordination complex of iron with dimethyldithiocarbamate with the formula Fe(S2CNMe2)3 (Me = methyl). It is marketed as a fungicide.
Synthesis, structure, bonding
Iron tris(dithiocarbamate)s are typically are prepared by salt metathesis reactions.{{cite book|chapter=The Chemistry of the Dithioacid and 1,1-Dithiolate Complexes|title=Progress in Inorganic Chemistry|volume=11|author=D. Coucouvanis|year=2007 |pages=233–371|doi=10.1002/9780470166123.ch4|isbn=978-0-470-16612-3 }}
Iron tris(dimethyldithiocarbamate) is an octahedral coordination complex of iron(III) with D3 symmetry.{{cite journal|title=Compounds with intermediate spin. I. The crystal structure of tris(N,N-dimethyldithiocarbamato)iron(III) at 150 and 295 K|pages=1871–1877|volume=33|journal=Acta Crystallographica Section B |author=J. Albertsson |author2=Å. Oskarsson |year=1977 |issue=6 |doi=10.1107/s0567740877007237|bibcode=1977AcCrB..33.1871A }}
Spin crossover (SCO) was first observed in 1931 by Cambi et al. who discovered anomalous magnetic behavior for the tris(N,N-dialkyldithiocarbamatoiron(III) complexes.{{cite journal|author1=L. Cambi |author2=L and L. Szego |journal = Chem. Ber. Dtsch. Ges.|year = 1931|volume = 64|page = 2591| doi = 10.1002/cber.19310641002| title = Über die magnetische Susceptibilität der komplexen Verbindungen| issue = 10}} The spin states of these complexes are sensitive to the nature of the amine substituents.{{cite book|author1=P. Gütlich |author2=H.A. Goodwin |title = Spin Crossover in Transition Metal Compounds I|publisher = Springer Berlin|year = 2004| isbn = 978-3-540-40396-8}}
Reactions
Iron tris(dithiocarbamate)s react with nitric oxide to give a nitrosyl complex:
:{{chem2|Fe(dtc)3 + NO -> Fe(dtc)2NO + 0.5 (dtc)2}}
This efficient chemical trapping reaction provides a means to detect NO.{{cite journal|author1=Fujii, S. |author2=Yoshimura, T. |title=A New Trend in Iron–Dithiocarbamate Complexes: as an Endogenous NO Trapping Agent|journal=Coordination Chemistry Reviews|year=2000|volume=198|pages=89–99|doi=10.1016/S0010-8545(99)00196-4}}
Reflecting the strongly donating properties of dithiocarbamate ligands, iron tris(dithiocarbamate)s oxidize at relatively mild potentials to give isolable iron(IV) derivatives [Fe(S2CNR2)3]+.{{cite journal|author1=Pasek, E. A. |author2=Straub, D. K. |title=Tris(N,N-Disubstituted Dithiocarbamato)iron(IV) Tetrafluoroborates|journal=Inorganic Chemistry|year=1972|volume=11|issue=2 |pages=259–263|doi=10.1021/ic50108a012}}
Iron tris(dithiocarbamate)s react with hydrochloric acid to give the pentacoordinate chloride:{{cite journal |doi=10.1021/ic50050a016|title=A Novel Series of fFive-Coordinated Iron(III) Complexes with the Square-Pyramidal Configuration and Spin, S = 3/2 |year=1967 |last1=Martin |first1=R. L. |last2=White |first2=A. H. |journal=Inorganic Chemistry |volume=6 |issue=4 |pages=712–717 }}
:{{chem2|Fe(dtc)3 + HCl -> Fe(dtc)2Cl + Hdtc}}
Safety
The U.S. Occupational Safety and Health Administration (OSHA) has set the legal (permissible exposure limit) for ferbam exposure in the workplace as 15 mg/m3 over an 8-hour workday. The U.S. National Institute for Occupational Safety and Health (NIOSH) has set a recommended exposure limit (REL) of 1 mg/m3 over an 8-hour workday. At levels of 800 mg/m3, ferbam is immediately dangerous to life and health.
See also
- Zinc dimethyldithiocarbamate - a related dimethyldithiocarbamate complex of zinc
- Nickel bis(dimethyldithiocarbamate) - a related dimethyldithiocarbamate complex of nickel
- Iron tris(diethyldithiocarbamate) - a related dimethyldithiocarbamate complex of iron