Isopropamide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477495412

| IUPAC_name = 4-amino-N,N-diisopropyl-N-methyl-4-oxo-3,3-diphenylbutan-1-aminium

| image = Isopropamide.png

| tradename =

| MedlinePlus = a694006

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US = Rx-only

| legal_US_comment = and Unscheduled

| legal_status = Unscheduled

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 7492-32-2

| ATC_prefix = A03

| ATC_suffix = AB09

| PubChem = 3775

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01625

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3643

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8B9I31H724

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201232

| C=23 | H=33 | N=2 | O=1 |charge=+

| smiles = O=C(N)C(c1ccccc1)(c2ccccc2)CC[N+](C(C)C)(C(C)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H32N2O/c1-18(2)25(5,19(3)4)17-16-23(22(24)26,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,16-17H2,1-5H3,(H-,24,26)/p+1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JTPUMZTWMWIVPA-UHFFFAOYSA-O

}}

Isopropamide (R79) is a long-acting anticholinergic drug. It is used in the treatment of peptic ulcers and other gastrointestinal disorders involving hyperacidity (gastrointestinal acidosis) and hypermotility.{{Citation needed|date=October 2024}} Chemically, it contains a quaternary ammonium group. It is most often provided as an iodide salt, but is also available as a bromide or chloride salt. It was discovered at Janssen Pharmaceutica in 1954.{{Citation needed|date=October 2024}}