Isopropylphenidate
{{Short description|Stimulant designer drugs}}
{{Distinguish|text = isopropylphenidine or N-Isopropyl-N'-phenyl-1,4-phenylenediamine, which is also called IPPD}}
{{Drugbox
| IUPAC_name = propan-2-yl 2-phenyl-2-(piperidin-2-yl)acetate
| image = Isopropylphenidate Structure.svg
| image_class = skin-invert-image
| width =
| tradename =
| routes_of_administration =
| legal_CA = Schedule III
| legal_UK = Class B
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 93148-46-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = N93Y7VG3XF
| ATC_suffix =
| PubChem = 68314762
| ChemSpiderID = 48062090
| C=16 | H=23 | N=1 | O=2
| molecular_weight =
| smiles = C1(=CC=CC=C1)C(C(=O)OC(C)C)C2CCCCN2
| StdInChI = 1S/C16H23NO2/c1-12(2)19-16(18)15(13-8-4-3-5-9-13)14-10-6-7-11-17-14/h3-5,8-9,12,14-15,17H,6-7,10-11H2,1-2H3
| StdInChIKey = AZVPADMEIMLODT-UHFFFAOYSA-N
}}
Isopropylphenidate (also known as IPH and IPPD) is a piperidine based stimulant drug, closely related to methylphenidate, but with the methyl ester replaced by an isopropyl ester. It has similar effects to methylphenidate but with a longer duration of action,{{cite journal | vauthors = Markowitz JS, Zhu HJ, Patrick KS | title = Isopropylphenidate: an ester homolog of methylphenidate with sustained and selective dopaminergic activity and reduced drug interaction liability | journal = Journal of Child and Adolescent Psychopharmacology | volume = 23 | issue = 10 | pages = 648–54 | date = December 2013 | pmid = 24261661 | doi = 10.1089/cap.2013.0074 | hdl = 2027.42/140321 | url = https://deepblue.lib.umich.edu/bitstream/2027.42/140321/1/cap.2013.0074.pdf | hdl-access = free }}{{cite patent | url=http://www.google.com/patents/US20120245201 | country = US | number = 20120245201 | status = application | title = Isopropylphenidate for Treatment of Attention-Deficit/Hyperactivity Disorder and Fatigue-Related Disorders and Conditions | pubdate = 2012-09-27 | inventor = Markowitz JS, Patrick KS, Zhu H }} and was banned in the UK as a Temporary Class Drug from April 2015 following its unapproved sale as a designer drug.{{cite web | url = https://www.gov.uk/government/uploads/system/uploads/attachment_data/file/420983/TCDO_methylphenidate_NPS.pdf | title = Methylphenidate-based NPS: A review of the evidence of use and harm. | work = Advisory Council on the Misuse of Drugs | date = 31 March 2015 }}
It has been researched as potential methylphenidate replacement for ADHD and narcolepsy, because of fewer side effects.{{cite journal|author=Florence Levy|title=Applications of pharmacogenetics in children with attention-deficit/hyperactivity disorder|journal=Pharmgenomics Pers Med|date=July 2014|pages=349–356}}