Isothipendyl

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{MCN|date=March 2024}}

{{Drugbox

| verifiedrevid = 443483940

| IUPAC_name = N,N-dimethyl-1-(10H-pyrido[3,2-b][1,4]benzothiazin-10-yl)propan-2-amine

| image = Isothipendyl.svg

| alt = Skeletal formula

| width = 180

| image2 = Isothipendyl molecule ball.png

| alt2 = Ball-and-stick model of isothipendyl

| tradename =

| Drugs.com = {{drugs.com|international|isothipendyl}}

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 482-15-5

| CAS_supplemental = {{CAS|1225-65-6}}

| ATC_prefix = D04

| ATC_suffix = AA22

| ATC_supplemental = {{ATC|R06|AD09}}

| PubChem = 3781

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08802

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3649

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WVZ7K9P0JY

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08091

| C=16 | H=19 | N=3 | S=1

| smiles = n2c1N(c3c(Sc1ccc2)cccc3)CC(N(C)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H19N3S/c1-12(18(2)3)11-19-13-7-4-5-8-14(13)20-15-9-6-10-17-16(15)19/h4-10,12H,11H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OQJBSDFFQWMKBQ-UHFFFAOYSA-N

}}

Isothipendyl is a 1st generation H₁ antagonist (antihistamine) and anticholinergic used as an antipruritic.{{cite journal | vauthors = Bibas N, Sartor V, Bulai Livideanu C, Bagheri H, Nougué J, Giordano-Labadie F, Maza A, Paul C, Chouini-Lalanne N, Marguery MC | display-authors = 6 | title = Contact photoallergy to isothipendyl chlorhydrate | journal = Dermatology | volume = 224 | issue = 4 | pages = 289–291 | date = 2012 | pmid = 22677929 | doi = 10.1159/000338024 | s2cid = 27580642 }} In the 2020s, at least, it is rarely used in the first line relief of allergies due to the anticholinergic side effect of somnolence but does have some limited use through topical application in the relief of insect bites and related itching (pruritus).{{cn|date=January 2023}}