Isotonitazepyne

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{drugbox

| drug_name = Isotonitazepyne

| image = Isotonitazepyne_structure.png

| legal_UK =

| legal_DE =

| C = 23 | H = 28 | N = 4 | O = 3

| IUPAC_name = 5-nitro-2-[4-(2-propoxy)benzyl]-1-[2-(pyrrolidin-1-yl)ethyl]-1H-benzo[d]imidazole

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 3053113-12-2

| ChemSpiderID = 128918598

| PubChem = 168322631

| StdInChI=1S/C23H28N4O3/c1-17(2)30-20-8-5-18(6-9-20)15-23-24-21-16-19(27(28)29)7-10-22(21)26(23)14-13-25-11-3-4-12-25/h5-10,16-17H,3-4,11-15H2,1-2H3

| StdInChIKey = VRKDSDBBRNHHCR-UHFFFAOYSA-N

| SMILES = CC(C)OC1=CC=C(C=C1)CC2=NC3=C(N2CCN4CCCC4)C=CC(=C3)[N+](=O)[O-]

}}

Isotonitazepyne (N-pyrrolidino isotonitazene) is a benzimidazole derivative with potent opioid effects, which has been sold as a designer drug over the internet. It was first identified by the drug checking service CanTEST in Australia in September 2024, {{Cite web | title = N-pyrrolidino isotonitazene found in counterfeit oxycodone pill r | date = 9 September 2024 | url = https://www.instagram.com/p/C_r_JiGus-7/?img_index=1 | url-status = live | archive-url = https://cantest.com.au/drug-notifications/ | archive-date = 9 September 2024 | access-date = 9 September 2024 | website = CanTEST | via = Instagram }}{{Cite journal | vauthors = Lawes DJ, Caldicott D, McLeod MD, Curtis B | title = Identification of the Novel Synthetic Opioid N-Pyrrolidino Isotonitazene at an Australian Drug Checking Service | journal = Drug Testing and Analysis | volume = n/a | issue = n/a | pmid = 40384477 | doi = 10.1002/dta.3910 | url = https://onlinelibrary.wiley.com/doi/abs/10.1002/dta.3910 | language = en | issn = 1942-7611 | doi-access = free }} and then later in Netherlands in May 2025. {{Cite web | vauthors = kevino | title = Waarschuwing: Namaak-oxycodonpillen met het levensgevaarlijke isotonitazepyne in omloop | date = 2025-03-18 | url = https://www.trimbos.nl/actueel/nieuws/waarschuwing-namaak-oxycodonpillen-met-het-levensgevaarlijke-isotonitazepyne-in-omloop/ | access-date = 2025-05-30 | website = Trimbos-instituut | language = nl-NL }} Its in vitro potency is approximately 1000 times that of morphine.{{cite journal | vauthors = De Vrieze LM, Walton SE, Pottie E, Papsun D, Logan BK, Krotulski AJ, Stove CP, Vandeputte MM | title = In vitro structure-activity relationships and forensic case series of emerging 2-benzylbenzimidazole 'nitazene' opioids | journal = Archives of Toxicology | volume = 98 | issue = 9 | pages = 2999–3018 | date = September 2024 | pmid = 38877156 | pmc = 11324687 | doi = 10.1007/s00204-024-03774-7 }}

==Legal Status==

This section is not exhaustive and does not include information for all countries with laws covering isotonitazepyne.