Isoxicam
{{Short description|Withdrawn NSAID analgesic drug}}
{{drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| image = Isoxicam skeletal V1.svg
| image_class = skin-invert-image
| width =
| image2 =
| width2 =
| tradename = Maxicam
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_US_comment =
| legal_AU =
| legal_AU_comment =
| legal_UK =
| legal_UK_comment =
| legal_status =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 34552-84-6
| ATC_prefix = M01
| ATC_suffix = AC03
| ATC_supplemental = (withdrawn)
| PubChem = 54677972
| IUPHAR_ligand =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB08942
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 10442695
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8XU734C4NG
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04639
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = CHEBI:76163
| ChEMBL_Ref =
| ChEMBL =
| PDB_ligand =
| C=14 | H=13 | Cl= | N=3 | O=5 | S=1
| smiles = CC1=CC(=NO1)NC(=O)C2=C(C3=CC=CC=C3S(=O)(=O)N2C)O
| StdInChI =
| StdInChIKey_Ref =
| StdInChIKey =
}}
Isoxicam is a nonsteroidal anti-inflammatory drug (NSAID) that was taken or applied to reduce inflammation and as an analgesic reducing pain in certain conditions. The drug was introduced in 1983 by the Warner-Lambert Company. Isoxicam is a chemical analog of piroxicam (Feldene) which has a pyridine ring in lieu of an isoxazole ring. In 1985 isoxicam was withdrawn from the French market, due to adverse effects, namely toxic epidermal necrolysis resulting in death. Although these serious side effects were observed only in France, the drug was withdrawn worldwide.Consolidated List of products whose consumption and/or sale have been banned, withdrawn, severely restricted or not approved by Governments, United Nations, 2003, p. 123 [https://web.archive.org/web/20141108234228/http://apps.who.int/medicinedocs/en/m/abstract/Js16780e/ link to 2005 ed]{{cite journal| vauthors = Fung M, Thornton A, Mybeck K, Wu JH, Hornbuckle K, Muniz E |title=Evaluation of the Characteristics of Safety Withdrawal of Prescription Drugs from Worldwide Pharmaceutical Markets-1960 to 1999|journal=Therapeutic Innovation & Regulatory Science|date= January 2001|volume=35|issue=1|pages=293–317|doi=10.1177/009286150103500134|s2cid=73036562 }}
References
{{Reflist}}
{{Anti-inflammatory products}}
{{Prostanoid signaling modulators}}
Category:Nonsteroidal anti-inflammatory drugs
Category:Drugs developed by Pfizer
{{analgesic-stub}}