JNJ-3792165

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name = JNJ-3792165

| image = JNJ-3792165_structure.png

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 353504-63-9

| PubChem = 2747070

| DrugBank =

| ChemSpiderID = 2028519

| IUPAC_name = 1-[(2,6-dichlorophenyl)methyl]-5-methyl-N-(3-methylphenyl)pyrazole-3-carboxamide

| C = 19 | H = 17 | Cl = 2 | N = 3 | O = 1

| StdInChI=1S/C19H17Cl2N3O/c1-12-5-3-6-14(9-12)22-19(25)18-10-13(2)24(23-18)11-15-16(20)7-4-8-17(15)21/h3-10H,11H2,1-2H3,(H,22,25)

| StdInChIKey = SKUQQQWNGFTXFN-UHFFFAOYSA-N

| SMILES = CC1=CC(=CC=C1)NC(=O)C2=NN(C(=C2)C)CC3=C(C=CC=C3Cl)Cl

}}

JNJ-3792165 is a chemical compound which acts as a small-molecule antagonist of the previously orphan receptor GPR139. It has been shown to modulate dopamine release in the brain via interaction with the Dopamine receptor D2, and increases the effect of morphine at the mu opioid receptor.{{cite journal | vauthors = Nepomuceno D, Kuei C, Dvorak C, Lovenberg T, Liu C, Bonaventure P | title = Re-evaluation of Adrenocorticotropic Hormone and Melanocyte Stimulating Hormone Activation of GPR139 in Vitro | journal = Frontiers in Pharmacology | volume = 9 | issue = | pages = 157 | date = 2018 | pmid = 29599718 | pmc = 5863515 | doi = 10.3389/fphar.2018.00157 | doi-access = free }}{{cite journal | vauthors = Wang L, Lee G, Kuei C, Yao X, Harrington A, Bonaventure P, Lovenberg TW, Liu C | display-authors = 6 | title = GPR139 and Dopamine D2 Receptor Co-express in the Same Cells of the Brain and May Functionally Interact | journal = Frontiers in Neuroscience | volume = 13 | issue = | pages = 281 | date = 2019 | pmid = 30971885 | pmc = 6443882 | doi = 10.3389/fnins.2019.00281 | doi-access = free }}{{cite journal | vauthors = Vedel L, Nøhr AC, Gloriam DE, Bräuner-Osborne H | title = Pharmacology and function of the orphan GPR139 G protein-coupled receptor | journal = Basic & Clinical Pharmacology & Toxicology | volume = 126 | issue = Suppl 6 | pages = 35–46 | date = June 2020 | pmid = 31132229 | pmc = 7318219 | doi = 10.1111/bcpt.13263 }}{{cite journal | vauthors = Zhou Y, Daver H, Trapkov B, Wu L, Wu M, Harpsøe K, Gentry PR, Liu K, Larionova M, Liu J, Chen N, Bräuner-Osborne H, Gloriam DE, Hua T, Liu ZJ | display-authors = 6 | title = Molecular insights into ligand recognition and G protein coupling of the neuromodulatory orphan receptor GPR139 | journal = Cell Research | volume = 32 | issue = 2 | pages = 210–213 | date = February 2022 | pmid = 34916631 | pmc = 8807744 | doi = 10.1038/s41422-021-00591-w }}{{cite journal | vauthors = Pallareti L, Rath TF, Trapkov B, Tsonkov T, Nielsen AT, Harpsøe K, Gentry PR, Bräuner-Osborne H, Gloriam DE, Foster SR | display-authors = 6 | title = Pharmacological characterization of novel small molecule agonists and antagonists for the orphan receptor GPR139 | journal = European Journal of Pharmacology | volume = 943 | issue = | pages = 175553 | date = March 2023 | pmid = 36736525 | doi = 10.1016/j.ejphar.2023.175553 | s2cid = 256562486 | doi-access = free }}

References