JWH-047

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (1-Butyl-2-methyl-1H-indol-3-yl)(7-methyl-1-naphthalenyl)methanone

| image = JWH-047.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US = Schedule I

| legal_DE = unscheduled{{cite web | title=Stoffe gem. Anlagen zum BtMG | url=https://www.bfarm.de/SharedDocs/Downloads/DE/Bundesopiumstelle/Betaeubungsmittel/BtM-Stoffe.xls?__blob=publicationFile | access-date=2024-11-23}}

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 316189-65-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8DQF9PUT4F

| ATC_prefix =

| ATC_suffix =

| PubChem =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID = 35303438

| C=25 | H=25 | N=1 | O=1

| smiles = CCCCn1c(c(c2c1cccc2)C(=O)c3cccc4c3cc(cc4)C)C

| StdInChI = 1S/C25H25NO/c1-4-5-15-26-18(3)24(21-10-6-7-12-23(21)26)25(27)20-11-8-9-19-14-13-17(2)16-22(19)20/h6-14,16H,4-5,15H2,1-3H3

| StdInChIKey = RQWLYQGWFKBOIY-UHFFFAOYSA-N

}}

JWH-047 is a selective cannabinoid ligand that binds to both CB₁ and CB₂. It has a bindining affinity of K_i = 0.9 nM for the CB₂ subtype, and more than 65 times selectivity over the CB₁.{{cite journal |vauthors=Aung MM, Griffin G, Huffman JW, Wu MJ, Keel C, Yang B, Showalter VM, Abood ME, Martin BR | title = Influence of the N-1 alkyl chain length of cannabimimetic indoles upon CB1 and CB2 receptor binding | journal = Drug and Alcohol Dependence | volume = 60 | issue = 2 | pages = 133–40 | year = 2000 | pmid = 10940540| doi = 10.1016/S0376-8716(99)00152-0 }}

In the United States, all CB₁ receptor agonists of the 3-(1-naphthoyl)indole class such as JWH-047 are Schedule I Controlled Substances.{{UnitedStatesCode2|21|812|Schedules of controlled substances}}