JWH-057

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (6aR,10aR)-3-(1,1-Dimethylheptyl)-6a,7,10,10a-tetrahydro-6,6,9-trimethyl-6H-Dibenzo[b,d]pyran

| image = JWH-057.svg

| tradename =

| legal_DE = unscheduled{{cite web | title=Stoffe gem. Anlagen zum BtMG | url=https://www.bfarm.de/SharedDocs/Downloads/DE/Bundesopiumstelle/Betaeubungsmittel/BtM-Stoffe.xls?__blob=publicationFile | access-date=2024-11-23}}

| legal_status =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 105823-04-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8I28LF0B2D

| PubChem =

| ChemSpiderID = 114395

| C=25 | H=38 | O=1

| smiles = CCCCCCC(C)(C)C1=CC2=C(C=C1)[C@@H]3CC(=CC[C@H]3C(O2)(C)C)C

| StdInChI = 1S/C25H38O/c1-7-8-9-10-15-24(3,4)19-12-13-20-21-16-18(2)11-14-22(21)25(5,6)26-23(20)17-19/h11-13,17,21-22H,7-10,14-16H2,1-6H3/t21-,22+/m0/s1

| StdInChIKey = JEEFMLVJZKFOFV-FCHUYYIVSA-N

}}

JWH-057, also known as deoxy-Δ8-THC-DMH, is a selective cannabinoid ligand, with a binding affinity of Ki = 2.9 ± 1.6 nM for the CB2 subtype, and Ki = 23 ± 7 nM for CB1.{{cite journal | vauthors = Huffman JW, Yu S, Showalter V, Abood ME, Wiley JL, Compton DR, Martin BR, Bramblett RD, Reggio PH | display-authors = 6 | title = Synthesis and pharmacology of a very potent cannabinoid lacking a phenolic hydroxyl with high affinity for the CB2 receptor | journal = Journal of Medicinal Chemistry | volume = 39 | issue = 20 | pages = 3875–7 | date = September 1996 | pmid = 8831752 | doi = 10.1021/JM960394Y }}

See also

References

{{reflist}}

{{Cannabinoids}}

Category:JWH cannabinoids

Category:Benzochromenes

{{cannabinoid-stub}}