JWH-148

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (4-Methyl-1-naphthalenyl)(2-methyl-1-propyl-1H-indol-3-yl)methanone

| image = JWH-148.png

| width = 150

| tradename =

| legal_status =

| routes_of_administration =

| legal_US = Schedule I

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 824955-99-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GJ5UPV38RK

| PubChem = 45267819

| ChemSpiderID = 24627234

| C=24 | H=23 | N=1 | O=1

| smiles = CCCN1C(=C(C2=CC=CC=C21)C(=O)C3=CC=C(C4=CC=CC=C43)C)C

| StdInChI = 1S/C24H23NO/c1-4-15-25-17(3)23(21-11-7-8-12-22(21)25)24(26)20-14-13-16(2)18-9-5-6-10-19(18)20/h5-14H,4,15H2,1-3H3

| StdInChIKey = WRIOMNWYCFMMEY-UHFFFAOYSA-N

}}

JWH-148 is a synthetic cannabimimetic that was discovered by John W. Huffman. It is the indole 2-methyl analog of JWH-120. It is a moderately selective ligand for the CB2 receptor, with a binding affinity of Ki = 14.0 ± 1.0 nM at this subtype, and more than eight times selectivity over the CB1 subtype.{{cite journal | vauthors = Huffman JW, Zengin G, Wu MJ, Lu J, Hynd G, Bushell K, Thompson AL, Bushell S, Tartal C, Hurst DP, Reggio PH, Selley DE, Cassidy MP, Wiley JL, Martin BR | display-authors = 6 | title = Structure-activity relationships for 1-alkyl-3-(1-naphthoyl)indoles at the cannabinoid CB(1) and CB(2) receptors: steric and electronic effects of naphthoyl substituents. New highly selective CB(2) receptor agonists | journal = Bioorganic & Medicinal Chemistry | volume = 13 | issue = 1 | pages = 89–112 | date = January 2005 | pmid = 15582455 | doi = 10.1016/j.bmc.2004.09.050 }}

In the United States, all CB1 receptor agonists of the 3-(1-naphthoyl)indole class such as JWH-148 are Schedule I Controlled Substances.{{UnitedStatesCode2|21|812|Schedules of controlled substances}}

See also

References