JWH-307

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 450663987

| IUPAC_name = (5-(2-Fluorophenyl)-1-pentylpyrrol-3-yl)-naphthalen-1-ylmethanone

| image = JWH-307.svg

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US = Schedule I

| legal_DE = Anlage II

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 914458-26-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 06QTR14ONW

| ATC_prefix =

| ATC_suffix =

| PubChem = 16049783

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID = 13178178

| C=26 | H=24 | F=1 | N=1 | O=1

| smiles = CCCCCN1C=C(C=C1C2=CC=CC=C2F)C(=O)C3=CC=CC4=CC=CC=C43

| StdInChI = 1S/C26H24FNO/c1-2-3-8-16-28-18-20(17-25(28)23-13-6-7-15-24(23)27)26(29)22-14-9-11-19-10-4-5-12-21(19)22/h4-7,9-15,17-18H,2-3,8,16H2,1H3

| StdInChIKey = WYNZPDDTQGVCLZ-UHFFFAOYSA-N

}}

JWH-307 is an analgesic drug used in scientific research, which acts as a cannabinoid agonist at both the CB₁ and CB₂ receptors. It is somewhat selective for the CB₂ subtype, with a K_i of 7.7 nM at CB₁ vs 3.3 nM at CB₂.Huffman JW, Padgett LW, Isherwood ML, Wiley JL, Martin BR. 1-Alkyl-2-aryl-4-(1-naphthoyl)pyrroles: New high affinity ligands for the cannabinoid CB₁ and CB₂ receptors. Bioorganic & Medicinal Chemistry Letters 2006; 16:5432-5435. It was discovered by, and named after, John W. Huffman. JWH-307 was detected as an ingredient in synthetic cannabis smoking blends in 2012, initially in Germany.{{cite journal | vauthors = Ernst L, Krüger K, Lindigkeit R, Schiebel HM, Beuerle T | title = Synthetic cannabinoids in "spice-like" herbal blends: first appearance of JWH-307 and recurrence of JWH-018 on the German market | journal = Forensic Science International | volume = 222 | issue = 1–3 | pages = 216–22 | date = October 2012 | pmid = 22748479 | doi = 10.1016/j.forsciint.2012.05.027 }}{{cite journal | vauthors = Kneisel S, Auwärter V | title = Analysis of 30 synthetic cannabinoids in serum by liquid chromatography-electrospray ionization tandem mass spectrometry after liquid-liquid extraction | journal = Journal of Mass Spectrometry | volume = 47 | issue = 7 | pages = 825–35 | date = July 2012 | pmid = 22791249 | doi = 10.1002/jms.3020 | bibcode = 2012JMSp...47..825K }}

In the United States, CB₁ receptor agonists of the 3-(1-naphthoyl)pyrrole class such as JWH-307 are Schedule I Controlled Substances.{{UnitedStatesCode2|21|812|Schedules of controlled substances}}