JWH-364
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| verifiedrevid =
| IUPAC_name = [5-(4-Ethylphenyl)-1-pentyl-1H-pyrrol-3-yl](1-naphthyl)methanone
| image = JWH-364.svg
| width =
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA = Schedule II
| legal_DE =
| legal_UK = Class B
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct}}
| CAS_number = 914458-36-9
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII =
| ATC_prefix =
| ATC_suffix =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL =
| PubChem = 44418348
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 23277926
| C=28 | H=29 | N=1 | O=1
| smiles = CCCCCN1C=C(C=C1C2=CC=C(C=C2)CC)C(=O)C3=CC=CC4=CC=CC=C43
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C28H29NO/c1-3-5-8-18-29-20-24(19-27(29)23-16-14-21(4-2)15-17-23)28(30)26-13-9-11-22-10-6-7-12-25(22)26/h6-7,9-17,19-20H,3-5,8,18H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VJWBAPGRMUZBEH-UHFFFAOYSA-N
}}
JWH-364 ([5-(4-Ethylphenyl)-1-pentyl-1H-pyrrol-3-yl](1-naphthyl)methanone) is a synthetic cannabinoid from the naphthoylpyrrole family which acts as an agonist of the CB1 (Ki = 34 ± 3nM) and CB2 (Ki = 29 ± 1nM) receptors, with a slight selectivity for the latter. JWH-364 was first synthesized in 2006 by John W. Huffman and colleagues to examine the nature of ligand binding to the CB1 receptor.{{cite journal | vauthors = Huffman JW, Padgett LW, Isherwood ML, Wiley JL, Martin BR | title = 1-Alkyl-2-aryl-4-(1-naphthoyl)pyrroles: new high affinity ligands for the cannabinoid CB1 and CB2 receptors | journal = Bioorganic & Medicinal Chemistry Letters | volume = 16 | issue = 20 | pages = 5432–5 | date = October 2006 | pmid = 16889960 | doi = 10.1016/j.bmcl.2006.07.051 }}
Legality
In the United States JWH-364 is not federally scheduled, although some states have passed legislation banning the sale, possession, and manufacture of JWH-364.{{UnitedStatesCode2|21|812|Schedules of controlled substances}}{{cite web |title=The 2020 Florida Statutes |url=http://www.leg.state.fl.us/Statutes/index.cfm?App_mode=Display_Statute&URL=0800-0899/0893/Sections/0893.03.html |website=www.leg.state.fl.us |access-date=20 August 2021}}{{cite web |title=Arizona Revised Statutes Title 13. Criminal Code § 13-3401 |url=https://www.azleg.gov/ars/13/03401.htm |website=www.azleg.gov |access-date=20 August 2021}}{{cite web |title=California Code, Health and Safety Code - HSC § 11357.5 |url=https://codes.findlaw.com/ca/health-and-safety-code/hsc-sect-11357-5.html |website=Findlaw}}
In Canada, JWH-364 and other naphthoylpyrrole-based cannabinoids are Schedule II controlled substances under the Controlled Drugs and Substances Act.
In the United Kingdom, JWH-364 and other naphthoylpyrrole-based cannabinoids are considered Class B drugs under the Misuse of Drugs Act 1971.
See also
References
{{reflist}}
{{Cannabinoids}}
Category:CB1 receptor agonists
Category:CB2 receptor agonists
{{Cannabinoid-stub}}